(S)-2-(3-((R)-3-carboxy-3-(4-iodobenzamido)propyl)ureido)Pentanedioic Acid

ID: ALA4514701

PubChem CID: 149751695

Max Phase: Preclinical

Molecular Formula: C17H20IN3O8

Molecular Weight: 521.26

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(O)CC[C@H](NC(=O)NCC[C@@H](NC(=O)c1ccc(I)cc1)C(=O)O)C(=O)O

Standard InChI:  InChI=1S/C17H20IN3O8/c18-10-3-1-9(2-4-10)14(24)20-12(16(27)28)7-8-19-17(29)21-11(15(25)26)5-6-13(22)23/h1-4,11-12H,5-8H2,(H,20,24)(H,22,23)(H,25,26)(H,27,28)(H2,19,21,29)/t11-,12+/m0/s1

Standard InChI Key:  BDIVGCNXIJGBNQ-NWDGAFQWSA-N

Molfile:  

 
     RDKit          2D

 29 29  0  0  0  0  0  0  0  0999 V2000
   20.2810  -16.3273    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.9928  -15.9187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7046  -16.3273    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.4165  -15.9187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1242  -16.3273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8360  -15.9187    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.1242  -17.1486    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.9928  -15.0974    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.4165  -15.0974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1242  -14.6847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1242  -13.8634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8360  -13.4548    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.4165  -13.4548    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.5691  -15.9187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8573  -16.3273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1455  -15.9187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4378  -16.3273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7259  -15.9187    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.4378  -17.1486    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.1455  -15.0974    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.4378  -14.6847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4378  -13.8634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7259  -15.0974    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.1479  -13.4568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1482  -12.6363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4400  -12.2227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7258  -12.6398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7289  -13.4590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4389  -11.4014    0.0000 I   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  5  7  2  0
  2  8  2  0
  4  9  1  1
  9 10  1  0
 10 11  1  0
 11 12  1  0
 11 13  2  0
  1 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 17 19  2  0
 16 20  1  6
 20 21  1  0
 21 22  1  0
 21 23  2  0
 22 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 22  1  0
 26 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4514701

    ---

Associated Targets(Human)

FOLH1 Tclin Glutamate carboxypeptidase II (711 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 521.26Molecular Weight (Monoisotopic): 521.0295AlogP: 0.48#Rotatable Bonds: 11
Polar Surface Area: 182.13Molecular Species: ACIDHBA: 5HBD: 6
#RO5 Violations: 2HBA (Lipinski): 11HBD (Lipinski): 6#RO5 Violations (Lipinski): 3
CX Acidic pKa: 2.74CX Basic pKa: CX LogP: 0.33CX LogD: -9.55
Aromatic Rings: 1Heavy Atoms: 29QED Weighted: 0.23Np Likeness Score: -0.66

References

1. Kim K, Kwon H, Barinka C, Motlova L, Nam S, Choi D, Ha H, Nam H, Son SH, Minn I, Pomper MG, Yang X, Kutil Z, Byun Y..  (2020)  Novel β- and γ-Amino Acid-Derived Inhibitors of Prostate-Specific Membrane Antigen.,  63  (6): [PMID:32097010] [10.1021/acs.jmedchem.9b02022]

Source