The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Methyl N-(4-acetoxycinnamoyl)anthranilate ID: ALA4514721
PubChem CID: 155539612
Max Phase: Preclinical
Molecular Formula: C19H17NO5
Molecular Weight: 339.35
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)c1ccccc1NC(=O)/C=C/c1ccc(OC(C)=O)cc1
Standard InChI: InChI=1S/C19H17NO5/c1-13(21)25-15-10-7-14(8-11-15)9-12-18(22)20-17-6-4-3-5-16(17)19(23)24-2/h3-12H,1-2H3,(H,20,22)/b12-9+
Standard InChI Key: QYZKQLJRMNXHFP-FMIVXFBMSA-N
Molfile:
RDKit 2D
25 26 0 0 0 0 0 0 0 0999 V2000
14.8401 -24.4290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8390 -25.2486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5470 -25.6575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2567 -25.2481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2538 -24.4254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5452 -24.0202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9600 -24.0142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6692 -24.4201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3754 -24.0088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0846 -24.4148 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.3723 -23.1917 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.7908 -24.0035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4961 -24.4112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2017 -24.0006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1991 -23.1825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4849 -22.7768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7821 -23.1897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4972 -25.2284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7901 -25.6380 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.2055 -25.6360 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.2066 -26.4532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1309 -25.6566 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.4235 -25.2474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7155 -25.6555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4242 -24.4303 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
5 7 1 0
7 8 2 0
8 9 1 0
9 10 1 0
9 11 2 0
10 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
13 18 1 0
18 19 2 0
18 20 1 0
20 21 1 0
2 22 1 0
22 23 1 0
23 24 1 0
23 25 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 339.35Molecular Weight (Monoisotopic): 339.1107AlogP: 3.05#Rotatable Bonds: 5Polar Surface Area: 81.70Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.06CX Basic pKa: ┄CX LogP: 3.83CX LogD: 3.83Aromatic Rings: 2Heavy Atoms: 25QED Weighted: 0.51Np Likeness Score: -0.36
References 1. Chandrabalan A, McPhillie MJ, Morice AH, Boa AN, Sadofsky LR.. (2019) N-Cinnamoylanthranilates as human TRPA1 modulators: Structure-activity relationships and channel binding sites., 170 [PMID:30878828 ] [10.1016/j.ejmech.2019.02.074 ]