(2S,2'S)-3,3'-(((((Azanediylbis(methylene))bis(1H-1,2,3-triazole-4,1-diyl))bis(propane-3,1-diyl))bis(2,1-phenylene))bis(oxy))bis-(1-(isopropylamino)propan-2-ol)

ID: ALA4514723

PubChem CID: 155539613

Max Phase: Preclinical

Molecular Formula: C36H55N9O4

Molecular Weight: 677.90

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(C)NC[C@H](O)COc1ccccc1CCCn1cc(CNCc2cn(CCCc3ccccc3OC[C@@H](O)CNC(C)C)nn2)nn1

Standard InChI:  InChI=1S/C36H55N9O4/c1-27(2)38-21-33(46)25-48-35-15-7-5-11-29(35)13-9-17-44-23-31(40-42-44)19-37-20-32-24-45(43-41-32)18-10-14-30-12-6-8-16-36(30)49-26-34(47)22-39-28(3)4/h5-8,11-12,15-16,23-24,27-28,33-34,37-39,46-47H,9-10,13-14,17-22,25-26H2,1-4H3/t33-,34-/m0/s1

Standard InChI Key:  NBTZMFMFCAFRPY-HEVIKAOCSA-N

Molfile:  

 
     RDKit          2D

 49 52  0  0  0  0  0  0  0  0999 V2000
   35.0206  -24.9239    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.8419  -24.9184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.2498  -24.2038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.0711  -24.1983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.4749  -23.4837    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   38.2962  -23.4782    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.7042  -22.7636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.7137  -24.1873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.8323  -23.4947    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.6165  -25.6433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6518  -25.6528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2476  -24.9384    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.4263  -24.9333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0180  -24.2190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1967  -24.2139    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7925  -23.4996    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.9712  -23.4945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5628  -22.7802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5541  -24.2038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4351  -23.5097    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.2191  -23.9709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9268  -23.5623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.6345  -23.9709    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.3422  -23.5623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.0499  -23.9709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1394  -24.7791    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.9387  -24.9490    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.3474  -24.2413    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.8005  -23.6341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.4707  -23.6427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.9239  -24.2500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.3325  -24.9578    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.1318  -24.7878    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.1635  -24.2392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.1059  -24.2475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.5739  -24.9459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3910  -24.9439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6951  -24.9539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8779  -24.9513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.4671  -25.6578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8014  -25.6505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2411  -26.3584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6475  -27.0683    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.4689  -27.0683    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8760  -26.3621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3941  -26.3557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8038  -27.0619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6219  -27.0603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.0285  -26.3466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 10  1  1  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  6  8  1  0
  3  9  1  1
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 17 19  1  0
 14 20  1  6
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  1  0
 29 25  2  0
 21 30  2  0
 30 31  1  0
 31 32  1  0
 32 33  2  0
 33 21  1  0
 28 34  1  0
 31 35  1  0
 34 36  1  0
 36 37  1  0
 35 38  1  0
 38 39  1  0
 39 40  1  0
 37 41  1  0
 40 11  2  0
 11 42  1  0
 42 43  2  0
 43 44  1  0
 44 45  2  0
 45 40  1  0
 41 46  2  0
 46 47  1  0
 47 48  2  0
 48 49  1  0
 49 10  2  0
 10 41  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4514723

    ---

Associated Targets(Human)

ADRB2 Tclin Beta-2 adrenergic receptor (11824 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
ADRB1 Tclin Beta-1 adrenergic receptor (6630 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 677.90Molecular Weight (Monoisotopic): 677.4377AlogP: 2.90#Rotatable Bonds: 24
Polar Surface Area: 156.43Molecular Species: BASEHBA: 13HBD: 5
#RO5 Violations: 2HBA (Lipinski): 13HBD (Lipinski): 5#RO5 Violations (Lipinski): 2
CX Acidic pKa: 13.79CX Basic pKa: 9.97CX LogP: 3.67CX LogD: -0.78
Aromatic Rings: 4Heavy Atoms: 49QED Weighted: 0.07Np Likeness Score: -0.75

References

1. Gaiser BI, Danielsen M, Marcher-Rørsted E, Røpke Jørgensen K, Wróbel TM, Frykman M, Johansson H, Bräuner-Osborne H, Gloriam DE, Mathiesen JM, Sejer Pedersen D..  (2019)  Probing the Existence of a Metastable Binding Site at the β2-Adrenergic Receptor with Homobivalent Bitopic Ligands.,  62  (17): [PMID:31298548] [10.1021/acs.jmedchem.9b00595]

Source