2-(4-(3-Hydroxyphenyl)-1H-1,2,3-triazol-1-yl)-N-(5-(4-(5-(2-phenylacetamido)-1,3,4-thiadiazol-2-yl)butyl)-1,3,4-thiadiazol-2-yl)-acetamide

ID: ALA4514727

PubChem CID: 155539403

Max Phase: Preclinical

Molecular Formula: C26H25N9O3S2

Molecular Weight: 575.68

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(Cc1ccccc1)Nc1nnc(CCCCc2nnc(NC(=O)Cn3cc(-c4cccc(O)c4)nn3)s2)s1

Standard InChI:  InChI=1S/C26H25N9O3S2/c36-19-10-6-9-18(14-19)20-15-35(34-29-20)16-22(38)28-26-33-31-24(40-26)12-5-4-11-23-30-32-25(39-23)27-21(37)13-17-7-2-1-3-8-17/h1-3,6-10,14-15,36H,4-5,11-13,16H2,(H,27,32,37)(H,28,33,38)

Standard InChI Key:  VSUQJNYIQZFSFT-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 40 44  0  0  0  0  0  0  0  0999 V2000
   28.9895  -13.0723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.7039  -12.6615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4185  -13.0718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4185  -13.8986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.7064  -14.3088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9895  -13.9039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.1329  -12.6605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.8473  -13.0718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.5618  -12.6605    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.2804  -13.0718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0337  -12.7376    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   34.5861  -13.3522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.1709  -14.0662    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.3662  -13.8956    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.4129  -13.3522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.8242  -14.0667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.6510  -14.0667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.0623  -14.7811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.8891  -14.7811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.3745  -14.1137    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   39.1598  -14.3701    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   39.1598  -15.1921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.3745  -15.4485    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   39.8741  -15.6076    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   40.5927  -15.1921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.3072  -15.6076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.0216  -15.1921    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   42.1075  -14.3724    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   42.9163  -14.2019    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   43.3273  -14.9158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.7790  -15.5306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.1541  -14.9158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.5700  -14.2016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.3932  -14.2026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.8046  -14.9173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.3982  -15.6320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.5721  -15.6346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.8044  -13.4840    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   40.5927  -14.3695    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.8473  -13.8986    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  6  5  2  0
  1  6  1  0
  3  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 11 10  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 10  2  0
 12 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 20 19  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 19  1  0
 22 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 28 27  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 27  1  0
 30 32  1  0
 33 32  2  0
 34 33  1  0
 35 34  2  0
 36 35  1  0
 37 36  2  0
 32 37  1  0
 34 38  1  0
 25 39  2  0
  8 40  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4514727

    ---

Associated Targets(Human)

GLS Tchem Glutaminase kidney isoform, mitochondrial (16997 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 575.68Molecular Weight (Monoisotopic): 575.1522AlogP: 3.74#Rotatable Bonds: 12
Polar Surface Area: 160.70Molecular Species: NEUTRALHBA: 12HBD: 3
#RO5 Violations: 2HBA (Lipinski): 12HBD (Lipinski): 3#RO5 Violations (Lipinski): 2
CX Acidic pKa: 6.57CX Basic pKa: 0.39CX LogP: 3.81CX LogD: 2.67
Aromatic Rings: 5Heavy Atoms: 40QED Weighted: 0.19Np Likeness Score: -1.51

References

1. Xu X, Kuang Z, Han J, Meng Y, Li L, Luan H, Xu P, Wang J, Luo C, Ding H, Li Z, Bian J..  (2019)  Development and Characterization of a Fluorescent Probe for GLS1 and the Application for High-Throughput Screening of Allosteric Inhibitors.,  62  (21): [PMID:31603674] [10.1021/acs.jmedchem.9b01035]

Source