The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(4-(3-Hydroxyphenyl)-1H-1,2,3-triazol-1-yl)-N-(5-(4-(5-(2-phenylacetamido)-1,3,4-thiadiazol-2-yl)butyl)-1,3,4-thiadiazol-2-yl)-acetamide ID: ALA4514727
PubChem CID: 155539403
Max Phase: Preclinical
Molecular Formula: C26H25N9O3S2
Molecular Weight: 575.68
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(Cc1ccccc1)Nc1nnc(CCCCc2nnc(NC(=O)Cn3cc(-c4cccc(O)c4)nn3)s2)s1
Standard InChI: InChI=1S/C26H25N9O3S2/c36-19-10-6-9-18(14-19)20-15-35(34-29-20)16-22(38)28-26-33-31-24(40-26)12-5-4-11-23-30-32-25(39-23)27-21(37)13-17-7-2-1-3-8-17/h1-3,6-10,14-15,36H,4-5,11-13,16H2,(H,27,32,37)(H,28,33,38)
Standard InChI Key: VSUQJNYIQZFSFT-UHFFFAOYSA-N
Molfile:
RDKit 2D
40 44 0 0 0 0 0 0 0 0999 V2000
28.9895 -13.0723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7039 -12.6615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.4185 -13.0718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.4185 -13.8986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7064 -14.3088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9895 -13.9039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1329 -12.6605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.8473 -13.0718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5618 -12.6605 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.2804 -13.0718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0337 -12.7376 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
34.5861 -13.3522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.1709 -14.0662 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.3662 -13.8956 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.4129 -13.3522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.8242 -14.0667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.6510 -14.0667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.0623 -14.7811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.8891 -14.7811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.3745 -14.1137 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.1598 -14.3701 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.1598 -15.1921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.3745 -15.4485 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
39.8741 -15.6076 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
40.5927 -15.1921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.3072 -15.6076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.0216 -15.1921 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
42.1075 -14.3724 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
42.9163 -14.2019 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
43.3273 -14.9158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.7790 -15.5306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.1541 -14.9158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.5700 -14.2016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.3932 -14.2026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.8046 -14.9173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.3982 -15.6320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.5721 -15.6346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.8044 -13.4840 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.5927 -14.3695 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.8473 -13.8986 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
6 5 2 0
1 6 1 0
3 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
11 10 1 0
11 12 1 0
12 13 2 0
13 14 1 0
14 10 2 0
12 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
20 19 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 19 1 0
22 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
28 27 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 27 1 0
30 32 1 0
33 32 2 0
34 33 1 0
35 34 2 0
36 35 1 0
37 36 2 0
32 37 1 0
34 38 1 0
25 39 2 0
8 40 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 575.68Molecular Weight (Monoisotopic): 575.1522AlogP: 3.74#Rotatable Bonds: 12Polar Surface Area: 160.70Molecular Species: NEUTRALHBA: 12HBD: 3#RO5 Violations: 2HBA (Lipinski): 12HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 6.57CX Basic pKa: 0.39CX LogP: 3.81CX LogD: 2.67Aromatic Rings: 5Heavy Atoms: 40QED Weighted: 0.19Np Likeness Score: -1.51
References 1. Xu X, Kuang Z, Han J, Meng Y, Li L, Luan H, Xu P, Wang J, Luo C, Ding H, Li Z, Bian J.. (2019) Development and Characterization of a Fluorescent Probe for GLS1 and the Application for High-Throughput Screening of Allosteric Inhibitors., 62 (21): [PMID:31603674 ] [10.1021/acs.jmedchem.9b01035 ]