5-benzyl-6-(3-fluorophenyl)-3-(3-hydroxypropyl)-1-methylpyrido[2,3-d]pyrimidine-2,4(1H,3H)-dione

ID: ALA4514737

PubChem CID: 118875519

Max Phase: Preclinical

Molecular Formula: C24H22FN3O3

Molecular Weight: 419.46

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cn1c(=O)n(CCCO)c(=O)c2c(Cc3ccccc3)c(-c3cccc(F)c3)cnc21

Standard InChI:  InChI=1S/C24H22FN3O3/c1-27-22-21(23(30)28(24(27)31)11-6-12-29)19(13-16-7-3-2-4-8-16)20(15-26-22)17-9-5-10-18(25)14-17/h2-5,7-10,14-15,29H,6,11-13H2,1H3

Standard InChI Key:  AOEGPLZHTLPXRP-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 31 34  0  0  0  0  0  0  0  0999 V2000
   32.5331   -5.6244    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.8199   -5.2117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.8199   -4.3903    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.5331   -3.9817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2422   -4.3903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.9554   -3.9817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6687   -4.3903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6687   -5.2117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.9554   -5.6244    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.2422   -5.2117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.1108   -5.6244    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.5331   -3.1604    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.5331   -6.4457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.1108   -3.9817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4017   -4.3903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4017   -5.2117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.9554   -3.1604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6687   -2.7477    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6687   -1.9264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.3819   -1.5178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.0910   -1.9264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.0910   -2.7477    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.3819   -3.1604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6899   -5.6244    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.4859   -4.3872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.8933   -5.0963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.7098   -5.0936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.1186   -4.3832    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.7009   -3.6741    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.8858   -3.6803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.1084   -2.9634    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
  1 10  1  0
  5 10  2  0
  2 11  2  0
  4 12  2  0
  1 13  1  0
 14 15  1  0
 15 16  1  0
  3 14  1  0
 17 18  1  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 18 23  2  0
  6 17  1  0
 16 24  1  0
  7 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 25  1  0
 29 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4514737

    ---

Associated Targets(Human)

TRPC5 Tchem Short transient receptor potential channel 5 (300 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 419.46Molecular Weight (Monoisotopic): 419.1645AlogP: 2.87#Rotatable Bonds: 6
Polar Surface Area: 77.12Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 1.26CX LogP: 3.46CX LogD: 3.46
Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.52Np Likeness Score: -0.98

References

1. Sharma S, Hopkins CR..  (2019)  Review of Transient Receptor Potential Canonical (TRPC5) Channel Modulators and Diseases.,  62  (17): [PMID:30943030] [10.1021/acs.jmedchem.8b01954]

Source