The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(1-cyanopyrrolidin-3-yl)-6-(4-(pyridin-4-yl)piperidin-1-yl)nicotinamide ID: ALA4514743
PubChem CID: 122590399
Max Phase: Preclinical
Molecular Formula: C21H24N6O
Molecular Weight: 376.46
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: N#CN1CCC(NC(=O)c2ccc(N3CCC(c4ccncc4)CC3)nc2)C1
Standard InChI: InChI=1S/C21H24N6O/c22-15-26-10-7-19(14-26)25-21(28)18-1-2-20(24-13-18)27-11-5-17(6-12-27)16-3-8-23-9-4-16/h1-4,8-9,13,17,19H,5-7,10-12,14H2,(H,25,28)
Standard InChI Key: DUFRQWNYGNGNMH-UHFFFAOYSA-N
Molfile:
RDKit 2D
28 31 0 0 0 0 0 0 0 0999 V2000
33.4807 -23.7487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2690 -23.7487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6841 -22.7041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5142 -22.7041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9292 -23.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5141 -24.7514 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.6840 -24.7515 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7175 -23.7486 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.1325 -22.7040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9626 -22.7040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3776 -23.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9626 -24.7514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1325 -24.7514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1659 -23.7485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5809 -24.7513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4110 -24.7513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8261 -23.7485 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.4111 -22.7039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5810 -22.7040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0657 -24.7933 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.0657 -22.7459 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.2356 -22.7459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.9459 -23.7069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.0741 -23.3309 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.0741 -22.1610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.9459 -21.7849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.0351 -24.0412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.9765 -24.7370 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 7 1 0
2 7 2 0
5 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
8 13 1 0
11 14 1 0
15 14 2 0
16 15 1 0
16 17 2 0
18 17 1 0
19 18 2 0
14 19 1 0
1 20 2 0
1 21 1 0
21 22 1 0
23 22 1 0
24 23 1 0
24 25 1 0
26 25 1 0
22 26 1 0
24 27 1 0
27 28 3 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 376.46Molecular Weight (Monoisotopic): 376.2012AlogP: 2.15#Rotatable Bonds: 4Polar Surface Area: 85.15Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 5.65CX LogP: 1.53CX LogD: 1.53Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.82Np Likeness Score: -1.70
References 1. (2018) 1-cyano-pyrrolidine compounds as usp30 inhibitors,