3-(1-(4-(4-bromophenyl)thiazol-2-yl)-3-methyl-1H-pyrazol-5-yl)-2H-chromen-2-one

ID: ALA4514746

PubChem CID: 129833249

Max Phase: Preclinical

Molecular Formula: C22H14BrN3O2S

Molecular Weight: 464.34

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1cc(-c2cc3ccccc3oc2=O)n(-c2nc(-c3ccc(Br)cc3)cs2)n1

Standard InChI:  InChI=1S/C22H14BrN3O2S/c1-13-10-19(17-11-15-4-2-3-5-20(15)28-21(17)27)26(25-13)22-24-18(12-29-22)14-6-8-16(23)9-7-14/h2-12H,1H3

Standard InChI Key:  BCXBNLSKBFXXDY-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 29 33  0  0  0  0  0  0  0  0999 V2000
    2.5583  -24.1135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5571  -24.9330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2652  -25.3420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2634  -23.7046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9720  -24.1099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9754  -24.9351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6877  -25.3425    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.4013  -24.9292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3979  -24.1040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6810  -23.6921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1101  -25.3359    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.1096  -23.6920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8572  -24.0221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4021  -23.4131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9913  -22.7066    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.1925  -22.8791    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.5862  -22.3338    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6690  -21.5208    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.9214  -21.1908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3765  -21.7999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7874  -22.5062    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    8.2173  -23.4096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9155  -20.3720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6240  -19.9593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6185  -19.1413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9059  -18.7362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1974  -19.1551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2064  -19.9718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8989  -17.9190    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  5 10  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  2  0
  8 11  2  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 12  1  0
  9 12  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 17  1  0
 16 17  1  0
 14 22  1  0
 19 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
 26 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4514746

    ---

Associated Targets(Human)

MCF7 (126967 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 464.34Molecular Weight (Monoisotopic): 462.9990AlogP: 5.84#Rotatable Bonds: 3
Polar Surface Area: 60.92Molecular Species: NEUTRALHBA: 6HBD:
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 1.44CX LogP: 5.73CX LogD: 5.73
Aromatic Rings: 5Heavy Atoms: 29QED Weighted: 0.31Np Likeness Score: -1.48

References

1. Zhang L, Xu Z..  (2019)  Coumarin-containing hybrids and their anticancer activities.,  181  [PMID:31404864] [10.1016/j.ejmech.2019.111587]

Source