The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E)-3-(2-(((3-(1-Benzylpiperidin-4-yl)-1,2,4-oxadiazol-5-yl)methyl)(methyl)amino)pyrimidin-5-yl)-N-hydroxyacrylamide ID: ALA4514748
PubChem CID: 155539430
Max Phase: Preclinical
Molecular Formula: C23H27N7O3
Molecular Weight: 449.52
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CN(Cc1nc(C2CCN(Cc3ccccc3)CC2)no1)c1ncc(/C=C/C(=O)NO)cn1
Standard InChI: InChI=1S/C23H27N7O3/c1-29(23-24-13-18(14-25-23)7-8-20(31)27-32)16-21-26-22(28-33-21)19-9-11-30(12-10-19)15-17-5-3-2-4-6-17/h2-8,13-14,19,32H,9-12,15-16H2,1H3,(H,27,31)/b8-7+
Standard InChI Key: MQRZZUXRFXUEQR-BQYQJAHWSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
18.3538 -16.9052 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.1709 -16.9052 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.4253 -16.1284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7623 -15.6463 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.1036 -16.1284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3921 -15.7165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1285 -15.7124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8405 -16.1133 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.5438 -15.6972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2544 -16.1002 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.9572 -15.6847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9489 -14.8667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2319 -14.4659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5320 -14.8837 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.3952 -14.8934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6878 -14.4815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9729 -14.8882 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.9698 -15.7113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6818 -16.1277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2672 -14.4760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2713 -13.6589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9821 -13.2571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9865 -12.4407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2804 -12.0277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5682 -12.4371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5673 -13.2522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8493 -16.9305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6517 -14.4496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3642 -14.8496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0670 -14.4326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7796 -14.8326 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.0571 -13.6154 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.7894 -15.6497 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 1 2 0
5 6 1 0
3 7 1 0
7 8 1 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
6 15 1 0
6 19 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
17 20 1 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
8 27 1 0
12 28 1 0
28 29 2 0
29 30 1 0
30 31 1 0
30 32 2 0
31 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 449.52Molecular Weight (Monoisotopic): 449.2175AlogP: 2.39#Rotatable Bonds: 8Polar Surface Area: 120.51Molecular Species: NEUTRALHBA: 9HBD: 2#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.57CX Basic pKa: 8.30CX LogP: 2.37CX LogD: 1.59Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.30Np Likeness Score: -1.55
References 1. Yang Z, Shen M, Tang M, Zhang W, Cui X, Zhang Z, Pei H, Li Y, Hu M, Bai P, Chen L.. (2019) Discovery of 1,2,4-oxadiazole-Containing hydroxamic acid derivatives as histone deacetylase inhibitors potential application in cancer therapy., 178 [PMID:31177073 ] [10.1016/j.ejmech.2019.05.089 ]