6-chloro-N-(2,4-dimethoxyphenyl)-1-(4-methoxyphenyl)-3,4-dihydro-1H-pyrido[3,4-b]indole-2(9H)-carboxamide

ID: ALA4514873

Cas Number: 1031540-29-0

PubChem CID: 50759098

Max Phase: Preclinical

Molecular Formula: C27H26ClN3O4

Molecular Weight: 491.98

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc(C2c3[nH]c4ccc(Cl)cc4c3CCN2C(=O)Nc2ccc(OC)cc2OC)cc1

Standard InChI:  InChI=1S/C27H26ClN3O4/c1-33-18-7-4-16(5-8-18)26-25-20(21-14-17(28)6-10-22(21)29-25)12-13-31(26)27(32)30-23-11-9-19(34-2)15-24(23)35-3/h4-11,14-15,26,29H,12-13H2,1-3H3,(H,30,32)

Standard InChI Key:  ZXMDULRSHHXKIU-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 35 39  0  0  0  0  0  0  0  0999 V2000
    4.2191  -13.4594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9203  -13.0436    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.9085  -12.2279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1955  -11.8280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2306  -14.2745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5267  -14.6918    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5370  -15.5081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2505  -15.9082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9551  -15.4860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9413  -14.6710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5107  -13.0640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4960  -12.2518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7428  -13.3289    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.2534  -12.6806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7191  -12.0175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3776  -11.2848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5707  -11.2140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1065  -11.8818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4506  -12.6118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6333  -13.4429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6440  -14.2600    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.3356  -13.0251    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.0486  -13.4244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0572  -14.2400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7694  -14.6392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4727  -14.2213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4593  -13.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7466  -13.0045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2242  -10.4739    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    4.2623  -16.7254    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5605  -17.1441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7323  -12.1874    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.4328  -11.7665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1862  -14.6197    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.1980  -15.4368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 12  4  1  0
 11  1  1  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  5  1  0
  1  5  1  0
 11 12  2  0
 12 15  1  0
 14 13  1  0
 13 11  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
  2 20  1  0
 20 21  2  0
 20 22  1  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
 17 29  1  0
  8 30  1  0
 30 31  1  0
 28 32  1  0
 32 33  1  0
 26 34  1  0
 34 35  1  0
M  END

Associated Targets(non-human)

Human gammaherpesvirus 4 (1538 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 491.98Molecular Weight (Monoisotopic): 491.1612AlogP: 6.03#Rotatable Bonds: 5
Polar Surface Area: 75.82Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 12.13CX Basic pKa: CX LogP: 5.02CX LogD: 5.02
Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.36Np Likeness Score: -0.99

References

1. Tikhmyanova N, Paparoidamis N, Romero-Masters J, Feng X, Mohammed FS, Reddy PAN, Kenney SC, Lieberman PM, Salvino JM..  (2019)  Development of a novel inducer for EBV lytic therapy.,  29  (16): [PMID:31255485] [10.1016/j.bmcl.2019.06.034]

Source