Onydecalin C

ID: ALA4514980

PubChem CID: 155539515

Max Phase: Preclinical

Molecular Formula: C21H28O3

Molecular Weight: 328.45

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C/C=C(\C)[C@H]1C(C)=C[C@H]2C[C@@H](C)C[C@H]3C(O)=C(C=O)C(=O)[C@]1(C)[C@H]23

Standard InChI:  InChI=1S/C21H28O3/c1-6-12(3)17-13(4)9-14-7-11(2)8-15-18(14)21(17,5)20(24)16(10-22)19(15)23/h6,9-11,14-15,17-18,23H,7-8H2,1-5H3/b12-6+/t11-,14-,15-,17+,18-,21+/m1/s1

Standard InChI Key:  AHKLFVACLXCZDW-SYSVLBGHSA-N

Molfile:  

 
     RDKit          2D

 27 29  0  0  0  0  0  0  0  0999 V2000
   19.5424   -9.9755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5424  -10.7886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2436  -11.1930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9454  -10.7927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6433  -11.1979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3492  -10.7946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3527   -9.9815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8394  -11.1982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9374  -11.5975    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   23.0546  -11.2071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0625   -9.5766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7640   -9.9890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.4697   -9.5841    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2436   -9.5628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9471   -9.9784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6505   -9.5784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6605   -8.7653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9610   -8.3538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2475   -8.7513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5268   -8.3244    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.9698   -7.5119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2459   -7.0874    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.3933   -8.3564    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.3696   -9.1542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9416   -9.1336    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   19.5135   -9.1418    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   23.0670   -8.7388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1 14  1  0
  2  3  1  0
  3  4  1  0
 15  4  1  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7 16  1  0
  2  8  1  1
  4  9  1  6
  6 10  1  0
  7 11  1  1
 11 12  2  0
 12 13  1  0
 14 15  1  0
 14 19  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 18 21  1  0
 21 22  2  0
 17 23  2  0
 16 24  1  6
 15 25  1  1
 14 26  1  6
 11 27  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4514980

    ---

Associated Targets(non-human)

Histoplasma capsulatum (403 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Candida albicans (78123 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Aspergillus fumigatus (16427 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 328.45Molecular Weight (Monoisotopic): 328.2038AlogP: 4.41#Rotatable Bonds: 2
Polar Surface Area: 54.37Molecular Species: ACIDHBA: 3HBD: 1
#RO5 Violations: HBA (Lipinski): 3HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 5.02CX Basic pKa: CX LogP: 3.76CX LogD: 1.41
Aromatic Rings: Heavy Atoms: 24QED Weighted: 0.46Np Likeness Score: 2.05

References

1. Lin Z, Phadke S, Lu Z, Beyhan S, Abdel Aziz MH, Reilly C, Schmidt EW..  (2018)  Onydecalins, Fungal Polyketides with Anti- Histoplasma and Anti-TRP Activity.,  81  (12): [PMID:30507122] [10.1021/acs.jnatprod.7b01067]

Source