The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N4,N8-Bis(3-(N',N'-dimethylamino)propyl)naphtho[2,1-b]thiophene-4,8-dicarboxamide ID: ALA4515129
PubChem CID: 24774173
Max Phase: Preclinical
Molecular Formula: C24H32N4O2S
Molecular Weight: 440.61
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CN(C)CCCNC(=O)c1ccc2cc(C(=O)NCCCN(C)C)c3sccc3c2c1
Standard InChI: InChI=1S/C24H32N4O2S/c1-27(2)12-5-10-25-23(29)18-8-7-17-15-21(24(30)26-11-6-13-28(3)4)22-19(9-14-31-22)20(17)16-18/h7-9,14-16H,5-6,10-13H2,1-4H3,(H,25,29)(H,26,30)
Standard InChI Key: DPACUNQJDPDMLA-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 33 0 0 0 0 0 0 0 0999 V2000
19.5347 -9.5584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5347 -10.3780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2436 -10.7841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9498 -10.3780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9498 -9.5584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2436 -9.1449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6542 -9.1461 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3656 -9.5587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9775 -9.0117 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
22.6441 -8.2601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8276 -8.3420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3656 -10.3755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6572 -10.7812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8261 -9.1515 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8242 -8.3343 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.1193 -9.5617 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.4107 -9.1547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7039 -9.5649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9953 -9.1579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2885 -9.5681 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.5798 -9.1611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2903 -10.3853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0726 -10.7853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0712 -11.6025 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.7810 -10.3779 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.4880 -10.7877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1964 -10.3803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9034 -10.7901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6118 -10.3827 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.3188 -10.7925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6132 -9.5655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 2 0
4 3 1 0
4 5 2 0
5 6 1 0
1 6 2 0
5 7 1 0
8 7 2 0
9 8 1 0
9 10 1 0
11 10 2 0
7 11 1 0
12 8 1 0
12 13 2 0
4 13 1 0
1 14 1 0
14 15 2 0
14 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
20 22 1 0
12 23 1 0
23 24 2 0
23 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
29 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 440.61Molecular Weight (Monoisotopic): 440.2246AlogP: 3.42#Rotatable Bonds: 10Polar Surface Area: 64.68Molecular Species: BASEHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 9.60CX LogP: 2.14CX LogD: -1.64Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.47Np Likeness Score: -1.05
References 1. Perin N, Rep V, Sović I, Juričić Š, Selgrad D, Klobučar M, Pržulj N, Gupta CL, Malod-Dognin N, Pavelić SK, Hranjec M.. (2020) Antiproliferative activity and mode of action analysis of novel amino and amido substituted phenantrene and naphtho[2,1-b]thiophene derivatives., 185 [PMID:31734024 ] [10.1016/j.ejmech.2019.111833 ]