2-Fluoro-N-((S)-1-oxo-1-(((S,E)-6-oxo-1-phenylhept-4-en-3-yl)-amino)-3-phenylpropan-2-yl)benzamide

ID: ALA4515298

PubChem CID: 155539986

Max Phase: Preclinical

Molecular Formula: C29H29FN2O3

Molecular Weight: 472.56

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(=O)/C=C/[C@H](CCc1ccccc1)NC(=O)[C@H](Cc1ccccc1)NC(=O)c1ccccc1F

Standard InChI:  InChI=1S/C29H29FN2O3/c1-21(33)16-18-24(19-17-22-10-4-2-5-11-22)31-29(35)27(20-23-12-6-3-7-13-23)32-28(34)25-14-8-9-15-26(25)30/h2-16,18,24,27H,17,19-20H2,1H3,(H,31,35)(H,32,34)/b18-16+/t24-,27+/m1/s1

Standard InChI Key:  XCKNSWOHPHOJLR-ZUQXLSGHSA-N

Molfile:  

 
     RDKit          2D

 35 37  0  0  0  0  0  0  0  0999 V2000
   40.5279  -15.9047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.2449  -15.4901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.2449  -14.6689    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   41.9582  -15.9049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.8148  -15.4900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.1016  -15.9047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.3884  -15.4900    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   37.6710  -15.9047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.9578  -15.4900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.2447  -15.9047    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.5315  -15.4900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.5315  -14.6687    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.8141  -15.9047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.8138  -16.7302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.1032  -17.1380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3896  -16.7273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3874  -15.9078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0966  -15.4916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0966  -14.6662    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   36.9578  -14.6687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.6710  -14.2540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.6714  -13.4286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.3862  -13.0206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.0997  -13.4315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.1019  -14.2510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.3886  -14.6671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.6710  -16.7301    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   39.1016  -16.7301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.8148  -17.1408    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.8148  -17.9661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.5278  -18.3770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.5309  -19.1988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.8133  -19.6138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.1040  -19.2040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.0971  -18.3792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  2  4  1  0
  1  5  2  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  2  0
 11 13  1  0
 14 13  2  0
 15 14  1  0
 16 15  2  0
 17 16  1  0
 18 17  2  0
 13 18  1  0
 18 19  1  0
  9 20  1  1
 20 21  1  0
 22 21  2  0
 23 22  1  0
 24 23  2  0
 25 24  1  0
 26 25  2  0
 21 26  1  0
  8 27  2  0
  6 28  1  6
 28 29  1  0
 29 30  1  0
 31 30  2  0
 32 31  1  0
 33 32  2  0
 34 33  1  0
 35 34  2  0
 30 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4515298

    ---

Associated Targets(Human)

CTSL Tclin Cathepsin L (3852 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

rhodesain Rhodesain (1463 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 472.56Molecular Weight (Monoisotopic): 472.2162AlogP: 4.43#Rotatable Bonds: 11
Polar Surface Area: 75.27Molecular Species: NEUTRALHBA: 3HBD: 2
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 13.26CX Basic pKa: CX LogP: 5.31CX LogD: 5.31
Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.41Np Likeness Score: -0.22

References

1. Ettari R, Previti S, Maiorana S, Amendola G, Wagner A, Cosconati S, Schirmeister T, Hellmich UA, Zappalà M..  (2019)  Optimization Strategy of Novel Peptide-Based Michael Acceptors for the Treatment of Human African Trypanosomiasis.,  62  (23): [PMID:31714776] [10.1021/acs.jmedchem.9b00908]

Source