6-Amino-N-(1-(2,6-dichloro-3-fluorophenyl)ethyl)-1'-methyl-2'-oxo-1',2'-dihydro-[3,4'-bipyridine]-5-carboxamide

ID: ALA4515316

PubChem CID: 155539675

Max Phase: Preclinical

Molecular Formula: C20H17Cl2FN4O2

Molecular Weight: 435.29

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(NC(=O)c1cc(-c2ccn(C)c(=O)c2)cnc1N)c1c(Cl)ccc(F)c1Cl

Standard InChI:  InChI=1S/C20H17Cl2FN4O2/c1-10(17-14(21)3-4-15(23)18(17)22)26-20(29)13-7-12(9-25-19(13)24)11-5-6-27(2)16(28)8-11/h3-10H,1-2H3,(H2,24,25)(H,26,29)

Standard InChI Key:  LEXJXOMDFWQGBY-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 29 31  0  0  0  0  0  0  0  0999 V2000
   16.8652  -28.8541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8641  -29.6815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5789  -30.0943    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.2953  -29.6810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2924  -28.8504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5770  -28.4414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1513  -28.4373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1532  -27.6114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4427  -27.1991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7259  -27.6083    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.7241  -28.4343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4391  -28.8510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0104  -30.0924    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.4457  -26.3742    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.0054  -28.4353    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7213  -28.8451    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.0022  -27.6103    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.7152  -27.1951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7120  -26.3701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4311  -27.6048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4241  -25.9582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4214  -25.1340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7048  -24.7233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9895  -25.1429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9958  -25.9657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1395  -26.3691    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   18.2849  -26.3844    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   21.1344  -24.7190    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   14.0129  -27.1932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  7  8  2  0
  7 12  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  2  0
  1  7  1  0
  4 13  1  0
  9 14  2  0
  5 15  1  0
 15 16  2  0
 15 17  1  0
 17 18  1  0
 18 19  1  0
 18 20  1  0
 19 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 19  1  0
 21 26  1  0
 25 27  1  0
 22 28  1  0
 10 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4515316

    ---

Associated Targets(Human)

KARPAS-299 (888 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 435.29Molecular Weight (Monoisotopic): 434.0713AlogP: 3.97#Rotatable Bonds: 4
Polar Surface Area: 90.01Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 4.97CX LogP: 3.52CX LogD: 3.52
Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.61Np Likeness Score: -1.30

References

1. Chen W, Guo X, Zhang C, Ke D, Zhang G, Yu Y..  (2019)  Discovery of 2-aminopyridines bearing a pyridone moiety as potent ALK inhibitors to overcome the crizotinib-resistant mutants.,  183  [PMID:31569004] [10.1016/j.ejmech.2019.111734]

Source