1-(azetidin-1-yl)-2-(6-(3-(trifluoromethyl)phenyl)-1H-pyrrolo[3,2-b]pyridin-1-yl)ethanone

ID: ALA4515350

PubChem CID: 124176023

Max Phase: Preclinical

Molecular Formula: C19H16F3N3O

Molecular Weight: 359.35

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(Cn1ccc2ncc(-c3cccc(C(F)(F)F)c3)cc21)N1CCC1

Standard InChI:  InChI=1S/C19H16F3N3O/c20-19(21,22)15-4-1-3-13(9-15)14-10-17-16(23-11-14)5-8-25(17)12-18(26)24-6-2-7-24/h1,3-5,8-11H,2,6-7,12H2

Standard InChI Key:  LHYFLTYKAZTAJM-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 26 29  0  0  0  0  0  0  0  0999 V2000
   26.3179  -23.0836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.3168  -23.9031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.0248  -24.3121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.0230  -22.6747    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.7317  -23.0800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7364  -23.8986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5165  -24.1470    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.9938  -23.4819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5087  -22.8225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7735  -24.9227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5738  -25.0880    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8309  -25.8637    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.1171  -24.4775    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.6087  -24.3111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9030  -23.9005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.1954  -24.3079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.1943  -25.1260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9067  -25.5350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6113  -25.1252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9089  -26.3521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.2023  -26.7627    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   25.6178  -26.7588    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   24.9037  -27.1654    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   29.4620  -26.5898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1923  -26.9566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.5590  -26.2263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9  5  1  0
  7 10  1  0
 10 11  1  0
 11 12  1  0
 11 13  2  0
  2 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
 18 20  1  0
 20 21  1  0
 20 22  1  0
 20 23  1  0
 12 24  1  0
 24 25  1  0
 25 26  1  0
 26 12  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4515350

    ---

Associated Targets(Human)

GRIN1 Tclin Glutamate NMDA receptor; GRIN1/GRIN2B (726 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
CYP2C9 Tchem Cytochrome P450 2C9 (32119 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
KCNH2 Tclin HERG (29587 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Grin2b Glutamate [NMDA] receptor subunit epsilon 2 (915 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 359.35Molecular Weight (Monoisotopic): 359.1245AlogP: 3.95#Rotatable Bonds: 3
Polar Surface Area: 38.13Molecular Species: NEUTRALHBA: 3HBD:
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 4.33CX LogP: 3.00CX LogD: 3.00
Aromatic Rings: 3Heavy Atoms: 26QED Weighted: 0.71Np Likeness Score: -1.89

References

1. Chrovian CC, Soyode-Johnson A, Wall JL, Rech JC, Schoellerman J, Lord B, Coe KJ, Carruthers NI, Nguyen L, Jiang X, Koudriakova T, Balana B, Letavic MA..  (2019)  1H-Pyrrolo[3,2-b]pyridine GluN2B-Selective Negative Allosteric Modulators.,  10  (3): [PMID:30891123] [10.1021/acsmedchemlett.8b00542]

Source