(R)-2-(3-(2-methyl-1H-indol-1-yl)propanamido)-3-(4-(pent-1-ynyl)phenyl)propanoic acid

ID: ALA4515387

PubChem CID: 155539721

Max Phase: Preclinical

Molecular Formula: C26H28N2O3

Molecular Weight: 416.52

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCCC#Cc1ccc(C[C@@H](NC(=O)CCn2c(C)cc3ccccc32)C(=O)O)cc1

Standard InChI:  InChI=1S/C26H28N2O3/c1-3-4-5-8-20-11-13-21(14-12-20)18-23(26(30)31)27-25(29)15-16-28-19(2)17-22-9-6-7-10-24(22)28/h6-7,9-14,17,23H,3-4,15-16,18H2,1-2H3,(H,27,29)(H,30,31)/t23-/m1/s1

Standard InChI Key:  WSSGSQIUQXAMLX-HSZRJFAPSA-N

Molfile:  

 
     RDKit          2D

 31 33  0  0  0  0  0  0  0  0999 V2000
    2.4749  -24.5652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4738  -25.3848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8887  -24.5616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1800  -24.1564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8915  -25.3843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1831  -25.7964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3560  -26.5975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1715  -26.6806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5023  -25.9307    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.5824  -27.3869    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3010  -25.7582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8498  -26.3637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6486  -26.1912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1974  -26.7967    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.8986  -25.4132    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.6974  -25.2407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9473  -24.4626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2462  -25.8462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7456  -24.2889    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.3981  -23.8560    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.0449  -25.6736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5893  -26.2815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3874  -26.1095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6380  -25.3308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0845  -24.7239    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2884  -24.8991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4366  -25.1572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2354  -24.9836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0341  -24.8117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5824  -25.4176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3813  -25.2458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  6  1  0
  5  3  1  0
  3  4  2  0
  4  1  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9  5  1  0
  8 10  1  0
  9 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  2  0
 13 15  1  0
 15 16  1  0
 16 17  1  1
 16 18  1  0
 17 19  1  0
 17 20  2  0
 18 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
 24 27  1  0
 27 28  3  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4515387

    ---

Associated Targets(Human)

IL2 Tchem Interleukin-2 (144 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 416.52Molecular Weight (Monoisotopic): 416.2100AlogP: 4.30#Rotatable Bonds: 8
Polar Surface Area: 71.33Molecular Species: ACIDHBA: 3HBD: 2
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 3.81CX Basic pKa: CX LogP: 5.21CX LogD: 1.95
Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.54Np Likeness Score: -0.72

References

1. Franzini RM, Randolph C..  (2016)  Chemical Space of DNA-Encoded Libraries.,  59  (14): [PMID:26914744] [10.1021/acs.jmedchem.5b01874]

Source