The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-4-(2-(2-Hydroxy-3-(isopropylamino)propoxy)phenyl)-N-(2-(4-phenylbutanamido)ethyl)butanamide ID: ALA4515576
PubChem CID: 155539979
Max Phase: Preclinical
Molecular Formula: C28H41N3O4
Molecular Weight: 483.65
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)NC[C@H](O)COc1ccccc1CCCC(=O)NCCNC(=O)CCCc1ccccc1
Standard InChI: InChI=1S/C28H41N3O4/c1-22(2)31-20-25(32)21-35-26-15-7-6-13-24(26)14-9-17-28(34)30-19-18-29-27(33)16-8-12-23-10-4-3-5-11-23/h3-7,10-11,13,15,22,25,31-32H,8-9,12,14,16-21H2,1-2H3,(H,29,33)(H,30,34)/t25-/m0/s1
Standard InChI Key: VDCQVPMVSIZVRR-VWLOTQADSA-N
Molfile:
RDKit 2D
35 36 0 0 0 0 0 0 0 0999 V2000
37.7039 -14.6655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.4135 -15.0854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.1293 -14.6767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.1333 -13.8508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.4156 -13.4353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.7028 -13.8464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9902 -15.1166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9890 -15.9440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7039 -16.3568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4203 -15.9435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4174 -15.1129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7021 -14.7038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6995 -13.8788 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.4128 -13.4642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4104 -12.6392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1236 -12.2246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6947 -12.2288 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.1304 -14.6978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1211 -11.3996 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.8343 -10.9850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8319 -10.1599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5500 -11.3953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8463 -15.1076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5593 -14.6924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2753 -15.1022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9882 -14.6870 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.7042 -15.0969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.4171 -14.6816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.1331 -15.0914 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.2784 -15.9272 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.8461 -14.6763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5620 -15.0861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8429 -13.8513 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.2750 -14.6708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9910 -15.0807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
15 17 1 1
11 18 1 0
16 19 1 0
19 20 1 0
20 21 1 0
20 22 1 0
18 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
25 30 2 0
29 31 1 0
31 32 1 0
31 33 2 0
32 34 1 0
34 35 1 0
35 1 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 483.65Molecular Weight (Monoisotopic): 483.3097AlogP: 3.00#Rotatable Bonds: 17Polar Surface Area: 99.69Molecular Species: BASEHBA: 5HBD: 4#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 9.67CX LogP: 3.28CX LogD: 1.06Aromatic Rings: 2Heavy Atoms: 35QED Weighted: 0.26Np Likeness Score: -0.45
References 1. Gaiser BI, Danielsen M, Marcher-Rørsted E, Røpke Jørgensen K, Wróbel TM, Frykman M, Johansson H, Bräuner-Osborne H, Gloriam DE, Mathiesen JM, Sejer Pedersen D.. (2019) Probing the Existence of a Metastable Binding Site at the β2 -Adrenergic Receptor with Homobivalent Bitopic Ligands., 62 (17): [PMID:31298548 ] [10.1021/acs.jmedchem.9b00595 ]