(S)-4-(2-(2-Hydroxy-3-(isopropylamino)propoxy)phenyl)-N-(2-(4-phenylbutanamido)ethyl)butanamide

ID: ALA4515576

PubChem CID: 155539979

Max Phase: Preclinical

Molecular Formula: C28H41N3O4

Molecular Weight: 483.65

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(C)NC[C@H](O)COc1ccccc1CCCC(=O)NCCNC(=O)CCCc1ccccc1

Standard InChI:  InChI=1S/C28H41N3O4/c1-22(2)31-20-25(32)21-35-26-15-7-6-13-24(26)14-9-17-28(34)30-19-18-29-27(33)16-8-12-23-10-4-3-5-11-23/h3-7,10-11,13,15,22,25,31-32H,8-9,12,14,16-21H2,1-2H3,(H,29,33)(H,30,34)/t25-/m0/s1

Standard InChI Key:  VDCQVPMVSIZVRR-VWLOTQADSA-N

Molfile:  

 
     RDKit          2D

 35 36  0  0  0  0  0  0  0  0999 V2000
   37.7039  -14.6655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.4135  -15.0854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.1293  -14.6767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.1333  -13.8508    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.4156  -13.4353    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.7028  -13.8464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9902  -15.1166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9890  -15.9440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7039  -16.3568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.4203  -15.9435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.4174  -15.1129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7021  -14.7038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6995  -13.8788    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.4128  -13.4642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.4104  -12.6392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.1236  -12.2246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6947  -12.2288    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.1304  -14.6978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.1211  -11.3996    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.8343  -10.9850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8319  -10.1599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.5500  -11.3953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8463  -15.1076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.5593  -14.6924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2753  -15.1022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.9882  -14.6870    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.7042  -15.0969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.4171  -14.6816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.1331  -15.0914    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.2784  -15.9272    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.8461  -14.6763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.5620  -15.0861    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.8429  -13.8513    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.2750  -14.6708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.9910  -15.0807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  7  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 15 17  1  1
 11 18  1  0
 16 19  1  0
 19 20  1  0
 20 21  1  0
 20 22  1  0
 18 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 25 30  2  0
 29 31  1  0
 31 32  1  0
 31 33  2  0
 32 34  1  0
 34 35  1  0
 35  1  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4515576

    ---

Associated Targets(Human)

ADRB2 Tclin Beta-2 adrenergic receptor (11824 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 483.65Molecular Weight (Monoisotopic): 483.3097AlogP: 3.00#Rotatable Bonds: 17
Polar Surface Area: 99.69Molecular Species: BASEHBA: 5HBD: 4
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 9.67CX LogP: 3.28CX LogD: 1.06
Aromatic Rings: 2Heavy Atoms: 35QED Weighted: 0.26Np Likeness Score: -0.45

References

1. Gaiser BI, Danielsen M, Marcher-Rørsted E, Røpke Jørgensen K, Wróbel TM, Frykman M, Johansson H, Bräuner-Osborne H, Gloriam DE, Mathiesen JM, Sejer Pedersen D..  (2019)  Probing the Existence of a Metastable Binding Site at the β2-Adrenergic Receptor with Homobivalent Bitopic Ligands.,  62  (17): [PMID:31298548] [10.1021/acs.jmedchem.9b00595]

Source