The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N4-(2-dimethylphosphorylphenyl)-N2-[1-(2-methoxyethyl)pyrazol-4-yl]thieno[2,3-d]pyrimidine-2,4-diamine ID: ALA4515607
PubChem CID: 155539907
Max Phase: Preclinical
Molecular Formula: C20H23N6O2PS
Molecular Weight: 442.49
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COCCn1cc(Nc2nc(Nc3ccccc3P(C)(C)=O)c3ccsc3n2)cn1
Standard InChI: InChI=1S/C20H23N6O2PS/c1-28-10-9-26-13-14(12-21-26)22-20-24-18(15-8-11-30-19(15)25-20)23-16-6-4-5-7-17(16)29(2,3)27/h4-8,11-13H,9-10H2,1-3H3,(H2,22,23,24,25)
Standard InChI Key: KRDMYBMBLAAYGH-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
14.2315 -3.8628 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.2304 -4.6865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9426 -5.0955 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.6564 -4.6860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6507 -3.8623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9408 -3.4499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1110 -2.6483 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
15.9261 -2.5637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2613 -3.3131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3695 -5.0923 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.3743 -5.9095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6687 -6.3181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6730 -7.1346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3836 -7.5399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0913 -7.1228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0834 -6.3077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7867 -5.8915 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
18.4988 -6.2925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7779 -5.0744 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.7808 -6.7073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5182 -5.0945 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.5176 -5.9159 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8556 -6.3994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1088 -7.1807 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.9302 -7.1813 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.1844 -6.4004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3408 -7.8926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1621 -7.8926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5728 -8.6039 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.3941 -8.6039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
6 5 2 0
6 1 1 0
7 6 1 0
8 7 1 0
9 8 2 0
5 9 1 0
4 10 1 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
16 17 1 0
17 18 1 0
17 19 2 0
17 20 1 0
2 21 1 0
21 22 1 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 1 0
26 22 2 0
25 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 442.49Molecular Weight (Monoisotopic): 442.1341AlogP: 4.27#Rotatable Bonds: 8Polar Surface Area: 93.96Molecular Species: NEUTRALHBA: 9HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.62CX Basic pKa: 2.35CX LogP: 2.64CX LogD: 2.64Aromatic Rings: 4Heavy Atoms: 30QED Weighted: 0.39Np Likeness Score: -2.19
References 1. Wang R, Chen Y, Zhao X, Yu S, Yang B, Wu T, Guo J, Hao C, Zhao D, Cheng M.. (2019) Design, synthesis and biological evaluation of novel 7H-pyrrolo[2,3-d]pyrimidine derivatives as potential FAK inhibitors and anticancer agents., 183 [PMID:31550660 ] [10.1016/j.ejmech.2019.111716 ]