The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-ethyl 2-((2R,3S,5S)-5-((tert-butyldiphenylsilyloxy)methyl)-2-(5-fluoro-2,4-dioxo-3,4-dihydropyrimidin-1(2H)-yl)tetrahydrofuran-3-yl)-2-hydroxypropanoate ID: ALA4515630
PubChem CID: 71599982
Max Phase: Preclinical
Molecular Formula: C30H37FN2O7Si
Molecular Weight: 584.72
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCOC(=O)[C@@](C)(O)[C@@H]1C[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O[C@H]1n1cc(F)c(=O)[nH]c1=O
Standard InChI: InChI=1S/C30H37FN2O7Si/c1-6-38-27(35)30(5,37)23-17-20(40-26(23)33-18-24(31)25(34)32-28(33)36)19-39-41(29(2,3)4,21-13-9-7-10-14-21)22-15-11-8-12-16-22/h7-16,18,20,23,26,37H,6,17,19H2,1-5H3,(H,32,34,36)/t20-,23+,26+,30-/m0/s1
Standard InChI Key: QWYIAOUQGBCOOM-LGQVRJFISA-N
Molfile:
RDKit 2D
42 45 0 0 0 0 0 0 0 0999 V2000
38.3997 -10.8257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.4039 -10.0085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.6941 -10.4136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9980 -6.1836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7221 -6.9553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2519 -7.5781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.0578 -7.4304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.3311 -6.6544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.7994 -6.0350 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8064 -7.1300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8053 -7.9495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5133 -8.3585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2230 -7.9490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2202 -7.1264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5115 -6.7211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9659 -8.4856 0.0000 Si 0 0 0 0 0 4 0 0 0 0 0 0
37.3803 -9.2203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.1975 -9.2203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.4518 -8.4436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.7889 -7.9614 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.1301 -8.4436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.2263 -8.1895 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.8323 -8.7392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.6070 -8.4907 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
40.7822 -7.6922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.1763 -7.1424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.3952 -7.3912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.3500 -6.3439 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
41.5607 -7.4437 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.6593 -9.5379 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.3528 -8.1914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.7458 -8.7385 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.3614 -9.0334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5834 -8.7833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.5339 -9.8321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.7937 -9.5587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.1920 -10.2245 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.7807 -9.9260 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
37.6921 -11.2320 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.1076 -11.2392 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.6902 -12.0492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9815 -12.4561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
2 3 1 1
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
16 13 1 0
6 16 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 17 1 0
22 23 1 0
22 27 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 2 0
19 22 1 1
26 28 1 0
25 29 2 0
23 30 2 0
21 31 1 1
31 32 1 0
32 16 1 0
16 33 1 0
33 34 1 0
33 35 1 0
33 36 1 0
18 2 1 0
2 37 1 0
18 38 1 1
1 39 1 0
1 40 2 0
39 41 1 0
41 42 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 584.72Molecular Weight (Monoisotopic): 584.2354AlogP: ┄#Rotatable Bonds: ┄Polar Surface Area: ┄Molecular Species: ┄HBA: ┄HBD: ┄#RO5 Violations: ┄HBA (Lipinski): ┄HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: ┄CX LogD: ┄Aromatic Rings: ┄Heavy Atoms: ┄QED Weighted: ┄Np Likeness Score: ┄
References 1. Brai A, Martelli F, Riva V, Garbelli A, Fazi R, Zamperini C, Pollutri A, Falsitta L, Ronzini S, Maccari L, Maga G, Giannecchini S, Botta M.. (2019) DDX3X Helicase Inhibitors as a New Strategy To Fight the West Nile Virus Infection., 62 (5): [PMID:30721061 ] [10.1021/acs.jmedchem.8b01403 ]