1-(4-bromophenyl)-4-(2-fluorophenyl)-5-methylene-1H-pyrrol-2(5H)-one

ID: ALA4515642

PubChem CID: 155539777

Max Phase: Preclinical

Molecular Formula: C17H11BrFNO

Molecular Weight: 344.18

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C=C1C(c2ccccc2F)=CC(=O)N1c1ccc(Br)cc1

Standard InChI:  InChI=1S/C17H11BrFNO/c1-11-15(14-4-2-3-5-16(14)19)10-17(21)20(11)13-8-6-12(18)7-9-13/h2-10H,1H2

Standard InChI Key:  XSXUYALIQBHOMF-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 21 23  0  0  0  0  0  0  0  0999 V2000
   31.4893  -25.9148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.4882  -26.7344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.1962  -27.1433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.9059  -26.7339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.9031  -25.9112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.1944  -25.5060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.7802  -27.1424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.0384  -26.8086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4911  -27.4155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8992  -28.1235    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.6986  -27.9541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.6785  -27.3294    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.3070  -28.4997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5703  -28.8692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7563  -28.9528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.4233  -29.6983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9034  -30.3607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.7201  -30.2728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.0492  -29.5272    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.7815  -25.5064    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   28.5714  -31.1075    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  2  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11  7  1  0
  9 12  2  0
 11 13  2  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
 10 14  1  0
  1 20  1  0
 17 21  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4515642

    ---

Associated Targets(non-human)

Pseudomonas aeruginosa (123386 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 344.18Molecular Weight (Monoisotopic): 343.0008AlogP: 4.53#Rotatable Bonds: 2
Polar Surface Area: 20.31Molecular Species: NEUTRALHBA: 1HBD:
#RO5 Violations: HBA (Lipinski): 2HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 4.10CX LogD: 4.10
Aromatic Rings: 2Heavy Atoms: 21QED Weighted: 0.78Np Likeness Score: -0.73

References

1. Almohaywi B, Yu TT, Iskander G, Chan DSH, Ho KKK, Rice S, Black DS, Griffith R, Kumar N..  (2019)  Dihydropyrrolones as bacterial quorum sensing inhibitors.,  29  (9): [PMID:30857746] [10.1016/j.bmcl.2019.03.004]

Source