The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E)-N-(4-(N-((3-(4-fluorobenzylideneamino)-4-oxo-3,4-dihydroquinazolin-2-yl)-2-phenylethyl)sulfamoyl)phenyl)acetamide ID: ALA4515750
PubChem CID: 155539911
Max Phase: Preclinical
Molecular Formula: C31H26FN5O4S
Molecular Weight: 583.65
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)Nc1ccc(S(=O)(=O)NC(Cc2ccccc2)c2nc3ccccc3c(=O)n2/N=C/c2ccc(F)cc2)cc1
Standard InChI: InChI=1S/C31H26FN5O4S/c1-21(38)34-25-15-17-26(18-16-25)42(40,41)36-29(19-22-7-3-2-4-8-22)30-35-28-10-6-5-9-27(28)31(39)37(30)33-20-23-11-13-24(32)14-12-23/h2-18,20,29,36H,19H2,1H3,(H,34,38)/b33-20+
Standard InChI Key: XNKPKIFRQOJCFZ-FMFFXOCNSA-N
Molfile:
RDKit 2D
42 46 0 0 0 0 0 0 0 0999 V2000
30.8496 -23.6122 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.4412 -22.8996 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
30.0284 -23.6095 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.4441 -21.6580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4429 -22.4853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1577 -22.8982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1559 -21.2452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8713 -21.6544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8701 -22.4828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5830 -22.8958 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.3017 -22.4848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3029 -21.6564 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.5854 -21.2388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0150 -22.8993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0127 -23.7243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7306 -22.4888 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.1595 -22.4928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2970 -24.1348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0184 -21.2456 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.0203 -20.4206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7357 -20.0098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.4479 -20.4250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1628 -20.0150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1653 -19.1891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.4468 -18.7749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7347 -19.1874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.8703 -22.9109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5854 -22.5012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5882 -21.6753 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.8698 -21.2609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1577 -21.6731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5866 -23.7169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8716 -24.1267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8687 -24.9525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5871 -25.3668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2993 -24.9547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3033 -21.2638 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.0171 -21.6774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7322 -21.2659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0159 -22.5024 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.5854 -20.4138 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.8802 -18.7774 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 9 2 0
8 7 2 0
7 4 1 0
8 9 1 0
8 13 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 1 0
11 14 1 0
14 15 1 0
14 16 1 0
16 2 1 0
2 17 1 0
15 18 1 0
12 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
17 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 17 1 0
18 32 2 0
32 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 18 1 0
29 37 1 0
37 38 1 0
38 39 1 0
38 40 2 0
13 41 2 0
24 42 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 583.65Molecular Weight (Monoisotopic): 583.1690AlogP: 4.64#Rotatable Bonds: 9Polar Surface Area: 122.52Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 10.19CX Basic pKa: 1.70CX LogP: 5.02CX LogD: 5.02Aromatic Rings: 5Heavy Atoms: 42QED Weighted: 0.24Np Likeness Score: -1.49
References 1. Patel TS, Bhatt JD, Dixit RB, Chudasama CJ, Patel BD, Dixit BC.. (2019) Green synthesis, biological evaluation, molecular docking studies and 3D-QSAR analysis of novel phenylalanine linked quinazoline-4(3H)-one-sulphonamide hybrid entities distorting the malarial reductase activity in folate pathway., 27 (16): [PMID:31272837 ] [10.1016/j.bmc.2019.06.038 ]