2,5-Dioxopyrrolidin-1-yl 2-(3-cyclohexyl-5-methyl-7-oxo-7H-furo[3,2-g]chromen-6-yl)acetate

ID: ALA4515753

PubChem CID: 155539912

Max Phase: Preclinical

Molecular Formula: C24H23NO7

Molecular Weight: 437.45

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1c(CC(=O)ON2C(=O)CCC2=O)c(=O)oc2cc3occ(C4CCCCC4)c3cc12

Standard InChI:  InChI=1S/C24H23NO7/c1-13-15-9-17-18(14-5-3-2-4-6-14)12-30-19(17)11-20(15)31-24(29)16(13)10-23(28)32-25-21(26)7-8-22(25)27/h9,11-12,14H,2-8,10H2,1H3

Standard InChI Key:  QNIITHODLNWRMI-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 36  0  0  0  0  0  0  0  0999 V2000
    4.9177   -5.7396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6234   -5.3327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6245   -4.5075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9159   -4.1022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2109   -4.5096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2097   -5.3306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4284   -5.5831    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.9467   -4.9182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4304   -4.2546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3358   -4.0936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0505   -4.5095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0493   -5.3347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3334   -5.7440    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.7557   -4.1059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3359   -3.2764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7558   -5.7453    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.1791   -3.4795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7307   -2.8728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4824   -2.1004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6861   -1.9263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1383   -2.5308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3869   -3.3095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4618   -4.5172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1711   -4.1113    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.4587   -5.3344    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.8772   -4.5226    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.9585   -5.3348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7572   -5.5077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1685   -4.8015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6239   -4.1923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7963   -3.3935    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.3489   -5.8790    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  3  2  1  0
  3  4  2  0
  4  5  1  0
  6  5  2  0
  6  1  1  0
  7  6  1  0
  8  7  1  0
  9  8  2  0
  5  9  1  0
  3 10  1  0
 11 10  2  0
 12 11  1  0
 13 12  1  0
  2 13  1  0
 11 14  1  0
 10 15  1  0
 12 16  2  0
  9 17  1  0
 17 18  1  0
 17 22  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 14 23  1  0
 23 24  1  0
 23 25  2  0
 24 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 26  1  0
 30 31  2  0
 27 32  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4515753

    ---

Associated Targets(Human)

PSMB8 Tclin Proteasome subunit beta type-8 (743 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 437.45Molecular Weight (Monoisotopic): 437.1475AlogP: 4.05#Rotatable Bonds: 4
Polar Surface Area: 107.03Molecular Species: NEUTRALHBA: 7HBD:
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 3.25CX LogD: 3.25
Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.45Np Likeness Score: 0.06

References

1. Schiffrer ES, Sosič I, Šterman A, Mravljak J, Raščan IM, Gobec S, Gobec M..  (2019)  A focused structure-activity relationship study of psoralen-based immunoproteasome inhibitors.,  10  (11): [PMID:32952997] [10.1039/C9MD00365G]

Source