N-(2-aminophenyl)-4-((4-methylene-1-(2-phenylallyl)-3,4-dihydroisoquinolin-2(1H)-yl)methyl)benzamide

ID: ALA4515877

PubChem CID: 155539654

Max Phase: Preclinical

Molecular Formula: C33H31N3O

Molecular Weight: 485.63

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C=C(CC1c2ccccc2C(=C)CN1Cc1ccc(C(=O)Nc2ccccc2N)cc1)c1ccccc1

Standard InChI:  InChI=1S/C33H31N3O/c1-23(26-10-4-3-5-11-26)20-32-29-13-7-6-12-28(29)24(2)21-36(32)22-25-16-18-27(19-17-25)33(37)35-31-15-9-8-14-30(31)34/h3-19,32H,1-2,20-22,34H2,(H,35,37)

Standard InChI Key:  VHOYKSDMDJBJMB-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 37 41  0  0  0  0  0  0  0  0999 V2000
   16.7767  -23.6160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4820  -23.2115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4820  -22.3943    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.7767  -21.9816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0714  -23.2115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0740  -22.3962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3702  -21.9881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6635  -22.3942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6649  -23.2127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3692  -23.6171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7767  -24.4332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1909  -21.9878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8974  -22.3985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8934  -23.2167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5991  -23.6273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3090  -23.2207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3088  -22.3993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6025  -21.9924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0160  -23.6305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0147  -24.4477    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.7244  -23.2230    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.4315  -23.6327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4274  -24.4508    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1336  -24.8604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8430  -24.4529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8417  -23.6315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1349  -23.2255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1335  -22.4083    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.7753  -21.1644    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4823  -20.7546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4808  -19.9374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1907  -21.1620    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1887  -19.5326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1876  -18.7162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4786  -18.3080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7693  -18.7222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7739  -19.5373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  6  4  1  0
  5  1  1  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  5  1  0
  1 11  2  0
  3 12  1  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 13  1  0
 16 19  1  0
 19 20  2  0
 19 21  1  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 22  1  0
 27 28  1  0
  4 29  1  0
 29 30  1  0
 30 31  1  0
 30 32  2  0
 31 33  2  0
 33 34  1  0
 34 35  2  0
 35 36  1  0
 36 37  2  0
 37 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4515877

    ---

Associated Targets(Human)

HDAC3 Tclin Histone deacetylase 3 (3654 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 485.63Molecular Weight (Monoisotopic): 485.2467AlogP: 7.19#Rotatable Bonds: 7
Polar Surface Area: 58.36Molecular Species: NEUTRALHBA: 3HBD: 2
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 8.02CX LogP: 6.77CX LogD: 6.06
Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.27Np Likeness Score: -0.36

References

1. Sangwan R, Rajan R, Mandal PK..  (2018)  HDAC as onco target: Reviewing the synthetic approaches with SAR study of their inhibitors.,  158  [PMID:30245394] [10.1016/j.ejmech.2018.08.073]

Source