The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(2-aminophenyl)-4-((4-methylene-1-(2-phenylallyl)-3,4-dihydroisoquinolin-2(1H)-yl)methyl)benzamide ID: ALA4515877
PubChem CID: 155539654
Max Phase: Preclinical
Molecular Formula: C33H31N3O
Molecular Weight: 485.63
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: C=C(CC1c2ccccc2C(=C)CN1Cc1ccc(C(=O)Nc2ccccc2N)cc1)c1ccccc1
Standard InChI: InChI=1S/C33H31N3O/c1-23(26-10-4-3-5-11-26)20-32-29-13-7-6-12-28(29)24(2)21-36(32)22-25-16-18-27(19-17-25)33(37)35-31-15-9-8-14-30(31)34/h3-19,32H,1-2,20-22,34H2,(H,35,37)
Standard InChI Key: VHOYKSDMDJBJMB-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 41 0 0 0 0 0 0 0 0999 V2000
16.7767 -23.6160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4820 -23.2115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4820 -22.3943 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.7767 -21.9816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0714 -23.2115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0740 -22.3962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3702 -21.9881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6635 -22.3942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6649 -23.2127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3692 -23.6171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7767 -24.4332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1909 -21.9878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8974 -22.3985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8934 -23.2167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5991 -23.6273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3090 -23.2207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3088 -22.3993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6025 -21.9924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0160 -23.6305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0147 -24.4477 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.7244 -23.2230 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.4315 -23.6327 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4274 -24.4508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1336 -24.8604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8430 -24.4529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8417 -23.6315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1349 -23.2255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1335 -22.4083 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.7753 -21.1644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4823 -20.7546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4808 -19.9374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1907 -21.1620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1887 -19.5326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1876 -18.7162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4786 -18.3080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7693 -18.7222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7739 -19.5373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6 4 1 0
5 1 1 0
1 2 1 0
2 3 1 0
3 4 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 5 1 0
1 11 2 0
3 12 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
16 19 1 0
19 20 2 0
19 21 1 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
27 28 1 0
4 29 1 0
29 30 1 0
30 31 1 0
30 32 2 0
31 33 2 0
33 34 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 485.63Molecular Weight (Monoisotopic): 485.2467AlogP: 7.19#Rotatable Bonds: 7Polar Surface Area: 58.36Molecular Species: NEUTRALHBA: 3HBD: 2#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 8.02CX LogP: 6.77CX LogD: 6.06Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.27Np Likeness Score: -0.36
References 1. Sangwan R, Rajan R, Mandal PK.. (2018) HDAC as onco target: Reviewing the synthetic approaches with SAR study of their inhibitors., 158 [PMID:30245394 ] [10.1016/j.ejmech.2018.08.073 ]