Rhinomilisin G

ID: ALA4515906

PubChem CID: 145720945

Max Phase: Preclinical

Molecular Formula: C15H24O4

Molecular Weight: 268.35

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(C)[C@H]1CC[C@H](CO)[C@@H]2[C@@H]1C=C(C(=O)O)C[C@H]2O

Standard InChI:  InChI=1S/C15H24O4/c1-8(2)11-4-3-9(7-16)14-12(11)5-10(15(18)19)6-13(14)17/h5,8-9,11-14,16-17H,3-4,6-7H2,1-2H3,(H,18,19)/t9-,11-,12-,13-,14-/m1/s1

Standard InChI Key:  HOOFHXDIUSHUEN-DKTYCGPESA-N

Molfile:  

 
     RDKit          2D

 21 22  0  0  0  0  0  0  0  0999 V2000
   17.7863   -4.0328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7863   -4.8584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4953   -5.2691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4953   -3.6178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2011   -3.2071    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   19.2052   -5.6799    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   18.4952   -6.0947    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7797   -6.5054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2108   -6.5056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4953   -2.7922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2085   -4.0328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2092   -4.8541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9175   -5.2639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6295   -4.8529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6288   -4.0316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9161   -3.6213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3449   -5.2681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3444   -6.0937    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.0607   -4.8536    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.9141   -2.7957    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.7798   -2.3773    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  4  1  0
  2  3  1  0
  3 12  1  0
 11  4  1  0
 11  5  1  6
 12  6  1  1
  3  7  1  1
  7  8  1  0
  7  9  1  0
  4 10  1  6
 11 12  1  0
 11 16  1  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  1  0
 14 17  1  0
 17 18  2  0
 17 19  1  0
 16 20  1  6
 10 21  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4515906

    ---

Associated Targets(non-human)

L5178Y (1809 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: YesOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 268.35Molecular Weight (Monoisotopic): 268.1675AlogP: 1.67#Rotatable Bonds: 3
Polar Surface Area: 77.76Molecular Species: ACIDHBA: 3HBD: 3
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 4.56CX Basic pKa: CX LogP: 1.38CX LogD: -1.38
Aromatic Rings: Heavy Atoms: 19QED Weighted: 0.73Np Likeness Score: 2.27

References

1. Liu S, Zhao Y, Heering C, Janiak C, Müller WEG, Akoné SH, Liu Z, Proksch P..  (2019)  Sesquiterpenoids from the Endophytic Fungus Rhinocladiella similis.,  82  (5): [PMID:31044595] [10.1021/acs.jnatprod.8b00938]

Source