7-(3-(Aminomethyl)-4-trifluoromethylphenyl)-4-methylquinolin-2-amine

ID: ALA4515973

PubChem CID: 155540231

Max Phase: Preclinical

Molecular Formula: C18H16F3N3

Molecular Weight: 331.34

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1cc(N)nc2cc(-c3ccc(C(F)(F)F)c(CN)c3)ccc12

Standard InChI:  InChI=1S/C18H16F3N3/c1-10-6-17(23)24-16-8-12(2-4-14(10)16)11-3-5-15(18(19,20)21)13(7-11)9-22/h2-8H,9,22H2,1H3,(H2,23,24)

Standard InChI Key:  MWZAFNMVLDEGCT-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 24 26  0  0  0  0  0  0  0  0999 V2000
   12.8012  -19.9675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8001  -20.7912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5123  -21.2042    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.5105  -19.5586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2232  -19.9639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2240  -20.7870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9367  -21.1982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6490  -20.7833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6443  -19.9570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9311  -19.5537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0879  -21.2033    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.5081  -18.7414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3548  -21.1851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3574  -22.0033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0570  -20.7736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7649  -21.1713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7756  -21.9952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0672  -22.4100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4676  -20.7540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1802  -21.1539    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.4871  -22.3970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4949  -23.2142    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   19.1909  -21.9817    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   19.1916  -22.8029    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  5  1  0
  2 11  1  0
  4 12  1  0
 13 14  2  0
 14 18  1  0
 15 13  1  0
  8 13  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 16 19  1  0
 19 20  1  0
 17 21  1  0
 21 22  1  0
 21 23  1  0
 21 24  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4515973

    ---

Associated Targets(non-human)

Nos1 Nitric-oxide synthase, brain (2987 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 331.34Molecular Weight (Monoisotopic): 331.1296AlogP: 4.27#Rotatable Bonds: 2
Polar Surface Area: 64.93Molecular Species: BASEHBA: 3HBD: 2
#RO5 Violations: HBA (Lipinski): 3HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 8.97CX LogP: 4.06CX LogD: 2.40
Aromatic Rings: 3Heavy Atoms: 24QED Weighted: 0.74Np Likeness Score: -0.53

References

1. Cinelli MA, Reidl CT, Li H, Chreifi G, Poulos TL, Silverman RB..  (2020)  First Contact: 7-Phenyl-2-Aminoquinolines, Potent and Selective Neuronal Nitric Oxide Synthase Inhibitors That Target an Isoform-Specific Aspartate.,  63  (9): [PMID:32302123] [10.1021/acs.jmedchem.9b01573]

Source