rac-4-(3-((4-((S)-Cyano((1R,2S)-2-methoxycyclopentyl)(phenyl)methyl)piperidin-1-yl)methyl)azetidin-1-yl)benzonitrile

ID: ALA4515980

PubChem CID: 132104449

Max Phase: Preclinical

Molecular Formula: C30H36N4O

Molecular Weight: 468.65

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CO[C@H]1CCC[C@@H]1[C@](C#N)(c1ccccc1)C1CCN(CC2CN(c3ccc(C#N)cc3)C2)CC1

Standard InChI:  InChI=1S/C30H36N4O/c1-35-29-9-5-8-28(29)30(22-32,25-6-3-2-4-7-25)26-14-16-33(17-15-26)19-24-20-34(21-24)27-12-10-23(18-31)11-13-27/h2-4,6-7,10-13,24,26,28-29H,5,8-9,14-17,19-21H2,1H3/t28-,29-,30+/m0/s1

Standard InChI Key:  XWVPFMAEIFLCFQ-OIFRRMEBSA-N

Molfile:  

 
     RDKit          2D

 36 40  0  0  0  0  0  0  0  0999 V2000
   23.0079   -4.8660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0067   -5.6855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7148   -6.0945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.4244   -5.6850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.4216   -4.8624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7130   -4.4571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7106   -3.6399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0016   -3.2334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0018   -2.4173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2969   -2.0109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5880   -2.4181    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.5885   -3.2363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2979   -3.6472    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.4170   -3.2292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.1649   -3.5575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7099   -2.9485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.2992   -2.2420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.5004   -2.4144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7027   -2.8189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8806   -2.0089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1726   -2.4170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3826   -2.2013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1705   -2.9905    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.9597   -3.2027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4655   -3.3971    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7578   -2.9862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0503   -3.3936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0492   -4.2116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7615   -4.6206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4662   -4.2109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3408   -4.6239    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6334   -5.0329    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.6948   -1.9979    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.3381   -4.3561    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.1164   -4.6054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.4126   -4.0447    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  6  7  1  0
  7  8  1  6
  8  9  1  0
  8 13  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
  7 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 14  1  0
  7 19  1  0
 11 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 21  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 25  1  0
 23 25  1  0
 31 32  3  0
 28 31  1  0
 19 33  3  0
 15 34  1  6
 34 35  1  0
 14 36  1  6
M  END

Alternative Forms

  1. Parent:

    ALA4515980

    ---

Associated Targets(Human)

MEN1 Tchem Menin (447 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MV4-11 (7307 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 468.65Molecular Weight (Monoisotopic): 468.2889AlogP: 4.98#Rotatable Bonds: 7
Polar Surface Area: 63.29Molecular Species: BASEHBA: 5HBD:
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 9.24CX LogP: 4.88CX LogD: 3.05
Aromatic Rings: 2Heavy Atoms: 35QED Weighted: 0.57Np Likeness Score: -0.89

References

1. Aguilar A, Zheng K, Xu T, Xu S, Huang L, Fernandez-Salas E, Liu L, Bernard D, Harvey KP, Foster C, McEachern D, Stuckey J, Chinnaswamy K, Delproposto J, Kampf JW, Wang S..  (2019)  Structure-Based Discovery of M-89 as a Highly Potent Inhibitor of the Menin-Mixed Lineage Leukemia (Menin-MLL) Protein-Protein Interaction.,  62  (13): [PMID:31244110] [10.1021/acs.jmedchem.9b00021]

Source