The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N,N'-(dodecane-1,12-diyl)bis(N',3,4-trimethoxybenzothioamide) ID: ALA4515989
PubChem CID: 155540280
Max Phase: Preclinical
Molecular Formula: C32H50N4O6
Molecular Weight: 586.77
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CO/N=C(\NCCCCCCCCCCCCN/C(=N\OC)c1ccc(OC)c(OC)c1)c1ccc(OC)c(OC)c1
Standard InChI: InChI=1S/C32H50N4O6/c1-37-27-19-17-25(23-29(27)39-3)31(35-41-5)33-21-15-13-11-9-7-8-10-12-14-16-22-34-32(36-42-6)26-18-20-28(38-2)30(24-26)40-4/h17-20,23-24H,7-16,21-22H2,1-6H3,(H,33,35)(H,34,36)
Standard InChI Key: GQGPDNAGODGLJA-UHFFFAOYSA-N
Molfile:
RDKit 2D
42 43 0 0 0 0 0 0 0 0999 V2000
21.4194 -9.4208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4182 -10.2482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1331 -10.6610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8494 -10.2477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8466 -9.4171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1312 -9.0080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5596 -9.0020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2755 -9.4118 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.5564 -8.1770 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.2693 -7.7618 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.9885 -8.9965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7045 -9.4064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.4174 -8.9912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1334 -9.4010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8463 -8.9858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5623 -9.3956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2752 -8.9804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9912 -9.3903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7042 -8.9750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4201 -9.3848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1331 -8.9697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8491 -9.3795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5620 -8.9642 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.2780 -9.3741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9909 -8.9589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2811 -10.1990 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.5683 -10.6142 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.7064 -9.3708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4187 -8.9563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4161 -8.1304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.6951 -7.7208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9856 -8.1376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1329 -11.4860 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.4183 -11.8983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7034 -10.6601 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.9893 -10.2470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.1285 -7.7143 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.8450 -8.1232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.6890 -6.8959 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.4005 -6.4781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2662 -6.9367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8522 -10.2045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
5 7 1 0
7 8 1 0
7 9 2 0
9 10 1 0
8 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
24 26 2 0
26 27 1 0
25 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 25 1 0
3 33 1 0
33 34 1 0
2 35 1 0
35 36 1 0
30 37 1 0
37 38 1 0
31 39 1 0
39 40 1 0
10 41 1 0
27 42 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 586.77Molecular Weight (Monoisotopic): 586.3730AlogP: 6.12#Rotatable Bonds: 21Polar Surface Area: 104.16Molecular Species: NEUTRALHBA: 8HBD: 2#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 6.70CX LogP: 6.42CX LogD: 6.34Aromatic Rings: 2Heavy Atoms: 42QED Weighted: 0.08Np Likeness Score: -0.15
References 1. Berger O, Ortial S, Wein S, Denoyelle S, Bressolle F, Durand T, Escale R, Vial HJ, Vo-Hoang Y.. (2019) Evaluation of amidoxime derivatives as prodrug candidates of potent bis-cationic antimalarials., 29 (16): [PMID:31255483 ] [10.1016/j.bmcl.2019.06.045 ]