N,N'-(dodecane-1,12-diyl)bis(N',3,4-trimethoxybenzothioamide)

ID: ALA4515989

PubChem CID: 155540280

Max Phase: Preclinical

Molecular Formula: C32H50N4O6

Molecular Weight: 586.77

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CO/N=C(\NCCCCCCCCCCCCN/C(=N\OC)c1ccc(OC)c(OC)c1)c1ccc(OC)c(OC)c1

Standard InChI:  InChI=1S/C32H50N4O6/c1-37-27-19-17-25(23-29(27)39-3)31(35-41-5)33-21-15-13-11-9-7-8-10-12-14-16-22-34-32(36-42-6)26-18-20-28(38-2)30(24-26)40-4/h17-20,23-24H,7-16,21-22H2,1-6H3,(H,33,35)(H,34,36)

Standard InChI Key:  GQGPDNAGODGLJA-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 42 43  0  0  0  0  0  0  0  0999 V2000
   21.4194   -9.4208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4182  -10.2482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1331  -10.6610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.8494  -10.2477    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.8466   -9.4171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1312   -9.0080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.5596   -9.0020    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.2755   -9.4118    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.5564   -8.1770    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.2693   -7.7618    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.9885   -8.9965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7045   -9.4064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.4174   -8.9912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.1334   -9.4010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8463   -8.9858    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5623   -9.3956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2752   -8.9804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9912   -9.3903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.7042   -8.9750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.4201   -9.3848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.1331   -8.9697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.8491   -9.3795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.5620   -8.9642    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.2780   -9.3741    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.9909   -8.9589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2811  -10.1990    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.5683  -10.6142    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.7064   -9.3708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.4187   -8.9563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.4161   -8.1304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.6951   -7.7208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.9856   -8.1376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1329  -11.4860    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.4183  -11.8983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7034  -10.6601    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.9893  -10.2470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.1285   -7.7143    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.8450   -8.1232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.6890   -6.8959    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.4005   -6.4781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.2662   -6.9367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.8522  -10.2045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  5  7  1  0
  7  8  1  0
  7  9  2  0
  9 10  1  0
  8 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 24 26  2  0
 26 27  1  0
 25 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 25  1  0
  3 33  1  0
 33 34  1  0
  2 35  1  0
 35 36  1  0
 30 37  1  0
 37 38  1  0
 31 39  1  0
 39 40  1  0
 10 41  1  0
 27 42  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4515989

    ---

Associated Targets(non-human)

Plasmodium vinckei petteri (380 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 586.77Molecular Weight (Monoisotopic): 586.3730AlogP: 6.12#Rotatable Bonds: 21
Polar Surface Area: 104.16Molecular Species: NEUTRALHBA: 8HBD: 2
#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 6.70CX LogP: 6.42CX LogD: 6.34
Aromatic Rings: 2Heavy Atoms: 42QED Weighted: 0.08Np Likeness Score: -0.15

References

1. Berger O, Ortial S, Wein S, Denoyelle S, Bressolle F, Durand T, Escale R, Vial HJ, Vo-Hoang Y..  (2019)  Evaluation of amidoxime derivatives as prodrug candidates of potent bis-cationic antimalarials.,  29  (16): [PMID:31255483] [10.1016/j.bmcl.2019.06.045]

Source