2-Amino-N-{2-chloro-5-[6-(piperazin-1-ylmethyl)pyridin-3-yl]phenyl}-1,3-oxazole-4-carboxamide

ID: ALA4516092

PubChem CID: 142393838

Max Phase: Preclinical

Molecular Formula: C20H21ClN6O2

Molecular Weight: 412.88

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Nc1nc(C(=O)Nc2cc(-c3ccc(CN4CCNCC4)nc3)ccc2Cl)co1

Standard InChI:  InChI=1S/C20H21ClN6O2/c21-16-4-2-13(9-17(16)25-19(28)18-12-29-20(22)26-18)14-1-3-15(24-10-14)11-27-7-5-23-6-8-27/h1-4,9-10,12,23H,5-8,11H2,(H2,22,26)(H,25,28)

Standard InChI Key:  SMVGWVVJRKDXHQ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 29 32  0  0  0  0  0  0  0  0999 V2000
   10.0004  -10.6396    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.4154   -9.5950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2093   -8.7176    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.2957   -9.2190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1703  -10.3889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2985   -8.5922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2985   -7.4223    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.3430   -9.2190    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.3458   -8.5922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3458   -7.4223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3904   -6.8373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4350   -7.4223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4350   -8.5922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3904   -9.2190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4378   -9.2190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4378  -10.3889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4823  -10.9739    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.4851  -10.3889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4851   -9.2190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4823   -8.5922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5297  -10.9739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5325  -10.3889    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.5325   -9.2190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5771   -8.5922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.5799   -9.2190    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.5799  -10.3889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5771  -10.9739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3430   -6.8373    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    8.2455   -9.4697    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  1  5  1  0
  4  6  1  0
  6  7  2  0
  6  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
  9 14  2  0
 13 15  1  0
 16 15  1  0
 16 17  2  0
 18 17  1  0
 19 18  2  0
 20 19  1  0
 15 20  2  0
 18 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 22 27  1  0
 10 28  1  0
  2 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4516092

    ---

Associated Targets(Human)

PAICS Tchem Multifunctional protein ADE2 (310 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MDA-MB-231 (73002 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 412.88Molecular Weight (Monoisotopic): 412.1415AlogP: 2.63#Rotatable Bonds: 5
Polar Surface Area: 109.31Molecular Species: BASEHBA: 7HBD: 3
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: 12.97CX Basic pKa: 9.22CX LogP: 1.77CX LogD: -0.04
Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.59Np Likeness Score: -1.71

References

1.  (2018)  Oxazole derivatives for use in the treatment of cancer, 

Source