1-(5-(3-Hydroxypropyl)-4-((5-methylpyridin-3-yl)oxy)pyridin-2-yl)-3-methylurea

ID: ALA4516141

PubChem CID: 155540236

Max Phase: Preclinical

Molecular Formula: C16H20N4O3

Molecular Weight: 316.36

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CNC(=O)Nc1cc(Oc2cncc(C)c2)c(CCCO)cn1

Standard InChI:  InChI=1S/C16H20N4O3/c1-11-6-13(10-18-8-11)23-14-7-15(20-16(22)17-2)19-9-12(14)4-3-5-21/h6-10,21H,3-5H2,1-2H3,(H2,17,19,20,22)

Standard InChI Key:  MFOQNGMSQDNKQC-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 23 24  0  0  0  0  0  0  0  0999 V2000
    6.8993  -19.9056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8982  -20.7251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6062  -21.1341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3159  -20.7246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3130  -19.9020    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.6044  -19.4967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1901  -21.1332    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.1895  -21.9503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4813  -22.3568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4803  -23.1733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1883  -23.5832    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8987  -23.1708    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.8962  -22.3557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7721  -23.5810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0242  -21.1321    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.7313  -20.7224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4396  -21.1299    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.7300  -19.9052    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.4371  -19.4955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1915  -19.4972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4839  -19.9059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7761  -19.4975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0685  -19.9063    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  2  7  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13  8  1  0
 10 14  1  0
  4 15  1  0
 15 16  1  0
 16 17  2  0
 16 18  1  0
 18 19  1  0
  1 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4516141

    ---

Associated Targets(Human)

GCK Tchem Hexokinase type IV (3191 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 316.36Molecular Weight (Monoisotopic): 316.1535AlogP: 2.25#Rotatable Bonds: 6
Polar Surface Area: 96.37Molecular Species: NEUTRALHBA: 5HBD: 3
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 11.83CX Basic pKa: 5.41CX LogP: 1.24CX LogD: 1.24
Aromatic Rings: 2Heavy Atoms: 23QED Weighted: 0.76Np Likeness Score: -0.65

References

1. Kohn TJ, Du X, Lai S, Xiong Y, Komorowski R, Veniant M, Fu Z, Jiao X, Pattaropong V, Chow D, Cardozo M, Jin L, Conn M, DeWolf WE, Kraser CF, Hinklin RJ, Boys ML, Medina JC, Houze J, Dransfield P, Coward P..  (2016)  5-Alkyl-2-urea-Substituted Pyridines: Identification of Efficacious Glucokinase Activators with Improved Properties.,  (7): [PMID:27437074] [10.1021/acsmedchemlett.6b00145]

Source