The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2,3-O,O-dibenzyl-6-deoxy-6-[4-(3-hydroxyphenyl)-1,2,3-triazol-1-yl]-L-ascorbic acid ID: ALA4516190
PubChem CID: 155540238
Max Phase: Preclinical
Molecular Formula: C28H25N3O6
Molecular Weight: 499.52
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C1O[C@H]([C@@H](O)Cn2cc(-c3cccc(O)c3)nn2)C(OCc2ccccc2)=C1OCc1ccccc1
Standard InChI: InChI=1S/C28H25N3O6/c32-22-13-7-12-21(14-22)23-15-31(30-29-23)16-24(33)25-26(35-17-19-8-3-1-4-9-19)27(28(34)37-25)36-18-20-10-5-2-6-11-20/h1-15,24-25,32-33H,16-18H2/t24-,25+/m0/s1
Standard InChI Key: QWMWPLJJHXYCLV-LOSJGSFVSA-N
Molfile:
RDKit 2D
38 42 0 0 0 0 0 0 0 0999 V2000
9.0251 -22.4860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1997 -22.4860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2645 -21.7019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9397 -21.7184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5959 -21.2231 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.2463 -21.2809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0445 -21.4336 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.5121 -23.1381 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.7292 -23.1546 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.5364 -21.6647 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.5901 -20.0345 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.2834 -20.4678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9768 -20.9012 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
5.8039 -20.2575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6227 -19.2178 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.8534 -18.9350 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.3512 -19.5786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5317 -19.5713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9090 -23.1496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4961 -23.8548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3263 -23.1372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7357 -23.8445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3250 -24.5505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7337 -25.2573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5518 -25.2569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9594 -24.5437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5484 -23.8399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6814 -23.8473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2686 -24.5516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6729 -25.2628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4943 -25.2652 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9034 -24.5602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1301 -18.8557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3113 -18.8480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8944 -19.5547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3023 -20.2705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1197 -20.2745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8899 -20.9760 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 1 1 0
4 2 1 0
5 3 1 0
6 4 1 0
7 3 2 0
8 1 1 0
9 2 1 0
6 10 1 1
11 12 1 0
12 6 1 0
4 13 1 6
4 5 1 0
14 11 1 0
11 15 1 0
15 16 2 0
16 17 1 0
17 14 2 0
17 18 1 0
9 19 1 0
19 20 1 0
8 21 1 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
20 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 20 1 0
18 33 2 0
33 34 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 18 1 0
36 38 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 499.52Molecular Weight (Monoisotopic): 499.1743AlogP: 3.58#Rotatable Bonds: 10Polar Surface Area: 115.93Molecular Species: NEUTRALHBA: 9HBD: 2#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.52CX Basic pKa: ┄CX LogP: 4.03CX LogD: 4.03Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.32Np Likeness Score: 0.00
References 1. Macan AM, Harej A, Cazin I, Klobučar M, Stepanić V, Pavelić K, Pavelić SK, Schols D, Snoeck R, Andrei G, Raić-Malić S.. (2019) Antitumor and antiviral activities of 4-substituted 1,2,3-triazolyl-2,3-dibenzyl-L-ascorbic acid derivatives., 184 [PMID:31586832 ] [10.1016/j.ejmech.2019.111739 ]