The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Ethyl 1-(4-(2-chloroacetamido)benzyl)-3-(4-phenoxyphenyl)-1H-pyrazole-5-carboxylate ID: ALA4516216
PubChem CID: 141741256
Max Phase: Preclinical
Molecular Formula: C27H24ClN3O4
Molecular Weight: 489.96
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCOC(=O)c1cc(-c2ccc(Oc3ccccc3)cc2)nn1Cc1ccc(NC(=O)CCl)cc1
Standard InChI: InChI=1S/C27H24ClN3O4/c1-2-34-27(33)25-16-24(20-10-14-23(15-11-20)35-22-6-4-3-5-7-22)30-31(25)18-19-8-12-21(13-9-19)29-26(32)17-28/h3-16H,2,17-18H2,1H3,(H,29,32)
Standard InChI Key: AGPUVVDNNDVFPC-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 38 0 0 0 0 0 0 0 0999 V2000
35.2451 -5.2312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.9120 -5.7034 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.5685 -5.2165 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.3060 -4.4399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4898 -4.4527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.9180 -6.5214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.6300 -6.9198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.7771 -3.7732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.5919 -3.8489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.0630 -3.1821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.7204 -2.4392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9022 -2.3672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4347 -3.0349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.1907 -1.7709 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.0046 -1.8441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.3444 -2.5894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.1575 -2.6628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.6287 -1.9941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.2810 -1.2499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.4689 -1.1800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.4707 -5.4922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8575 -4.9520 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.6373 -7.7342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.3485 -8.1325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.0505 -7.7151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.0369 -6.8951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.3252 -6.5004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.7642 -8.1132 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.7763 -8.9303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.4899 -9.3284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.0747 -9.3493 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.5020 -10.1455 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
34.3095 -6.2933 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.0831 -5.2130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4699 -4.6728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 1 2 0
6 7 1 0
6 2 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
4 8 1 0
11 14 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
1 21 1 0
21 22 1 0
7 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 7 1 0
25 28 1 0
28 29 1 0
29 30 1 0
29 31 2 0
30 32 1 0
21 33 2 0
22 34 1 0
34 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 489.96Molecular Weight (Monoisotopic): 489.1455AlogP: 5.74#Rotatable Bonds: 9Polar Surface Area: 82.45Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.54CX Basic pKa: 0.71CX LogP: 5.71CX LogD: 5.71Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.24Np Likeness Score: -1.49
References 1. Ran F, Liu Y, Zhang D, Liu M, Zhao G.. (2019) Discovery of novel pyrazole derivatives as potential anticancer agents in MCL., 29 (9): [PMID:30857748 ] [10.1016/j.bmcl.2019.03.005 ]