4-(4-(1-(4-(thiiran-2-ylmethylsulfonyl)phenyl)-1H-1,2,3-triazol-4-yl)phenyl)pyridine

ID: ALA4516243

PubChem CID: 155540134

Max Phase: Preclinical

Molecular Formula: C22H18N4O2S2

Molecular Weight: 434.55

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=S(=O)(CC1CS1)c1ccc(-n2cc(-c3ccc(-c4ccncc4)cc3)nn2)cc1

Standard InChI:  InChI=1S/C22H18N4O2S2/c27-30(28,15-20-14-29-20)21-7-5-19(6-8-21)26-13-22(24-25-26)18-3-1-16(2-4-18)17-9-11-23-12-10-17/h1-13,20H,14-15H2

Standard InChI Key:  YCXZBBJJRRZVJF-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 30 34  0  0  0  0  0  0  0  0999 V2000
    3.8012   -2.8932    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5907   -2.1049    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    3.0132   -2.6813    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.8432   -2.4474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8421   -3.2669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5501   -3.6759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2598   -3.2665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2570   -2.4438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5483   -2.0385    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9646   -3.6732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9646   -4.4915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6721   -4.8989    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3801   -4.4891    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.3762   -3.6677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6681   -3.2640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1354   -2.0398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0498   -1.2271    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.2504   -1.0574    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.8419   -1.7652    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.3889   -2.3723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0310   -1.8520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5509   -1.1894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7389   -1.2746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4060   -2.0219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8912   -2.6847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7014   -2.5961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1120   -1.4483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2994   -1.5351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5470   -1.2062    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    1.6338   -2.0188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 10  1  0
  7 10  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  1  0
 20 16  2  0
  4 16  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
 19 21  1  0
 24  2  1  0
  2 27  1  0
 27 28  1  0
 29 28  1  0
 30 29  1  0
 28 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4516243

    ---

Associated Targets(Human)

MMP2 Tchem Matrix metalloproteinase-2 (6627 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 434.55Molecular Weight (Monoisotopic): 434.0871AlogP: 3.89#Rotatable Bonds: 6
Polar Surface Area: 77.74Molecular Species: NEUTRALHBA: 7HBD:
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 4.99CX LogP: 3.41CX LogD: 3.41
Aromatic Rings: 4Heavy Atoms: 30QED Weighted: 0.43Np Likeness Score: -1.49

References

1. Pathania S, Narang RK, Rawal RK..  (2019)  Role of sulphur-heterocycles in medicinal chemistry: An update.,  180  [PMID:31330449] [10.1016/j.ejmech.2019.07.043]

Source