2-Methyl-5-oxo-4-pentyl-N-(o-tolyl)-1,4,5,6,7,8-hexahydroquinoline-3-carboxamide

ID: ALA4516265

PubChem CID: 155540222

Max Phase: Preclinical

Molecular Formula: C23H30N2O2

Molecular Weight: 366.51

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCCCC1C(C(=O)Nc2ccccc2C)=C(C)NC2=C1C(=O)CCC2

Standard InChI:  InChI=1S/C23H30N2O2/c1-4-5-6-11-17-21(23(27)25-18-12-8-7-10-15(18)2)16(3)24-19-13-9-14-20(26)22(17)19/h7-8,10,12,17,24H,4-6,9,11,13-14H2,1-3H3,(H,25,27)

Standard InChI Key:  AQUSBQUOURZUPB-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 27 29  0  0  0  0  0  0  0  0999 V2000
   22.0807  -11.2673    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.0807  -12.0887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7901  -12.4972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7901  -10.8546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.4995  -11.2673    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.4960  -12.0886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.2022  -12.5021    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.9164  -12.0946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9198  -11.2733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.2091  -10.8595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7901  -10.0333    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.6218  -12.5113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6297  -10.8685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6340  -10.0472    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.3394  -11.2808    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.0533  -10.8759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7623  -11.2902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.4758  -10.8860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.4805  -10.0639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7659   -9.6476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.0553  -10.0582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7568  -12.1074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.2115  -10.0423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9203   -9.6357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9227   -8.8185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6316   -8.4120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.3381   -8.8226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  4  1  0
  2  3  1  0
  3  6  1  0
  5  4  1  0
  5  6  2  0
  5 10  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
  4 11  2  0
  8 12  1  0
  9 13  1  0
 13 14  2  0
 13 15  1  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
 17 22  1  0
 10 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4516265

    ---

Associated Targets(Human)

FFAR3 Tchem Free fatty acid receptor 3 (304 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 366.51Molecular Weight (Monoisotopic): 366.2307AlogP: 5.01#Rotatable Bonds: 6
Polar Surface Area: 58.20Molecular Species: NEUTRALHBA: 3HBD: 2
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 4.35CX LogD: 4.35
Aromatic Rings: 1Heavy Atoms: 27QED Weighted: 0.70Np Likeness Score: -0.92

References

1. Ulven ER, Quon T, Sergeev E, Barki N, Brvar M, Hudson BD, Dutta P, Hansen AH, Bielefeldt LØ, Tobin AB, McKenzie CJ, Milligan G, Ulven T..  (2020)  Structure-Activity Relationship Studies of Tetrahydroquinolone Free Fatty Acid Receptor 3 Modulators.,  63  (7): [PMID:32141297] [10.1021/acs.jmedchem.9b02036]

Source