The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(3-Hydroxypropyl)-2-(4-(3-hydroxypropyl)-2-methoxyphenoxy)-6-methoxyphenol ID: ALA4516404
PubChem CID: 101052649
Max Phase: Preclinical
Molecular Formula: C20H26O6
Molecular Weight: 362.42
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(CCCO)ccc1Oc1cc(CCCO)cc(OC)c1O
Standard InChI: InChI=1S/C20H26O6/c1-24-17-11-14(5-3-9-21)7-8-16(17)26-19-13-15(6-4-10-22)12-18(25-2)20(19)23/h7-8,11-13,21-23H,3-6,9-10H2,1-2H3
Standard InChI Key: RKWMPFMPGQRKBC-UHFFFAOYSA-N
Molfile:
RDKit 2D
26 27 0 0 0 0 0 0 0 0999 V2000
23.5031 -3.6319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5020 -4.4515 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2100 -4.8604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9197 -4.4510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9169 -3.6283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2083 -3.2231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6230 -3.2171 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.3323 -3.6230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3320 -4.4378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0404 -4.8437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7476 -4.4324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7419 -3.6110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0329 -3.2088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0256 -2.3917 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.7296 -1.9768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2058 -2.4059 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.7953 -3.2235 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.7951 -2.4063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2098 -5.6776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5020 -6.0860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4574 -4.8374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4615 -5.6545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5018 -6.9032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1713 -6.0595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1755 -6.8767 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.7940 -7.3117 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
5 7 1 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
13 14 1 0
14 15 1 0
6 16 1 0
1 17 1 0
17 18 1 0
3 19 1 0
19 20 1 0
11 21 1 0
21 22 1 0
20 23 1 0
22 24 1 0
24 25 1 0
23 26 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 362.42Molecular Weight (Monoisotopic): 362.1729AlogP: 3.05#Rotatable Bonds: 10Polar Surface Area: 88.38Molecular Species: NEUTRALHBA: 6HBD: 3#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.35CX Basic pKa: ┄CX LogP: 2.79CX LogD: 2.78Aromatic Rings: 2Heavy Atoms: 26QED Weighted: 0.60Np Likeness Score: 0.58
References 1. Ferreira DD, Sousa FS, Costa-Silva TA, Reimão JQ, Torrecilhas AC, Johns DM, Sear CE, Honorio KM, Lago JHG, Anderson EA, Tempone AG, Tempone AG.. (2019) Dehydrodieugenol B derivatives as antiparasitic agents: Synthesis and biological activity against Trypanosoma cruzi., 176 [PMID:31103897 ] [10.1016/j.ejmech.2019.05.001 ]