The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-Amino-N-(2-chloro-5-{2-[3-(dimethylamino)propoxy]-1,3-thiazol-5-yl}phenyl)-1,3-oxazole-4-carboxamide ID: ALA4516565
PubChem CID: 135186867
Max Phase: Preclinical
Molecular Formula: C18H20ClN5O3S
Molecular Weight: 421.91
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CN(C)CCCOc1ncc(-c2ccc(Cl)c(NC(=O)c3coc(N)n3)c2)s1
Standard InChI: InChI=1S/C18H20ClN5O3S/c1-24(2)6-3-7-26-18-21-9-15(28-18)11-4-5-12(19)13(8-11)22-16(25)14-10-27-17(20)23-14/h4-5,8-10H,3,6-7H2,1-2H3,(H2,20,23)(H,22,25)
Standard InChI Key: RAAQEXZSAQIBOV-UHFFFAOYSA-N
Molfile:
RDKit 2D
28 30 0 0 0 0 0 0 0 0999 V2000
8.8751 -7.8779 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.2856 -6.8673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0856 -5.9831 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.1804 -6.4462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0541 -7.6252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1910 -5.8568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1910 -4.6778 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.2436 -6.4462 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.2542 -5.8568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2542 -4.6778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3068 -4.0883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3174 -4.6778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3174 -5.8568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3068 -6.4462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3700 -6.4462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4413 -5.9379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2727 -6.8111 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.7191 -7.8418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5472 -7.6217 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
18.2275 -8.9130 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.4273 -9.0172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9356 -10.0885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1354 -10.1927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6437 -11.2640 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.9523 -12.2309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8215 -11.3323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2436 -4.0883 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
7.1066 -6.7410 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
1 5 1 0
4 6 1 0
6 7 2 0
6 8 1 0
8 9 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
9 14 2 0
13 15 1 0
16 15 2 0
17 16 1 0
18 17 2 0
19 18 1 0
19 15 1 0
18 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
24 26 1 0
10 27 1 0
2 28 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 421.91Molecular Weight (Monoisotopic): 421.0975AlogP: 3.62#Rotatable Bonds: 8Polar Surface Area: 106.51Molecular Species: BASEHBA: 8HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.87CX Basic pKa: 9.26CX LogP: 2.76CX LogD: 0.91Aromatic Rings: 3Heavy Atoms: 28QED Weighted: 0.53Np Likeness Score: -1.62
References 1. (2018) Oxazole derivatives for use in the treatment of cancer,