2-Amino-N-{2-chloro-5-[6-(piperidin-4-yloxy)pyridin-3-yl]phenyl}-1,3-oxazole-4-carboxamide

ID: ALA4516567

PubChem CID: 135186895

Max Phase: Preclinical

Molecular Formula: C20H20ClN5O3

Molecular Weight: 413.87

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Nc1nc(C(=O)Nc2cc(-c3ccc(OC4CCNCC4)nc3)ccc2Cl)co1

Standard InChI:  InChI=1S/C20H20ClN5O3/c21-15-3-1-12(9-16(15)25-19(27)17-11-28-20(22)26-17)13-2-4-18(24-10-13)29-14-5-7-23-8-6-14/h1-4,9-11,14,23H,5-8H2,(H2,22,26)(H,25,27)

Standard InChI Key:  RMFRIFVLGGWOPU-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 29 32  0  0  0  0  0  0  0  0999 V2000
   11.5090   -9.2728    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.9196   -8.2201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7196   -7.3359    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.8143   -7.8412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6880   -9.0202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8249   -7.2517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8249   -6.0306    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.8776   -7.8412    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.8881   -7.2517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8881   -6.0306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9408   -5.4411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9513   -6.0306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9513   -7.2517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9408   -7.8412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0040   -7.8412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0040   -9.0202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0145   -9.6097    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.0672   -9.0202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0672   -7.8412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0145   -7.2517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1199   -9.6097    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.1304   -9.0202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.1831   -9.6097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.1936   -9.0202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.1936   -7.8412    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.1831   -7.2517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1304   -7.8412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8776   -5.4411    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    9.7406   -8.0938    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  1  5  1  0
  4  6  1  0
  6  7  2  0
  6  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
  9 14  2  0
 13 15  1  0
 16 15  1  0
 16 17  2  0
 18 17  1  0
 19 18  2  0
 20 19  1  0
 15 20  2  0
 18 21  1  0
 21 22  1  0
 23 22  1  0
 24 23  1  0
 25 24  1  0
 25 26  1  0
 27 26  1  0
 22 27  1  0
 10 28  1  0
  2 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4516567

    ---

Associated Targets(Human)

PAICS Tchem Multifunctional protein ADE2 (310 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MDA-MB-231 (73002 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 413.87Molecular Weight (Monoisotopic): 413.1255AlogP: 3.36#Rotatable Bonds: 5
Polar Surface Area: 115.30Molecular Species: BASEHBA: 7HBD: 3
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: 12.98CX Basic pKa: 9.82CX LogP: 2.36CX LogD: 0.00
Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.59Np Likeness Score: -1.29

References

1.  (2018)  Oxazole derivatives for use in the treatment of cancer, 

Source