The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-Amino-N-{2-chloro-5-[6-(piperidin-4-yloxy)pyridin-3-yl]phenyl}-1,3-oxazole-4-carboxamide ID: ALA4516567
PubChem CID: 135186895
Max Phase: Preclinical
Molecular Formula: C20H20ClN5O3
Molecular Weight: 413.87
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Nc1nc(C(=O)Nc2cc(-c3ccc(OC4CCNCC4)nc3)ccc2Cl)co1
Standard InChI: InChI=1S/C20H20ClN5O3/c21-15-3-1-12(9-16(15)25-19(27)17-11-28-20(22)26-17)13-2-4-18(24-10-13)29-14-5-7-23-8-6-14/h1-4,9-11,14,23H,5-8H2,(H2,22,26)(H,25,27)
Standard InChI Key: RMFRIFVLGGWOPU-UHFFFAOYSA-N
Molfile:
RDKit 2D
29 32 0 0 0 0 0 0 0 0999 V2000
11.5090 -9.2728 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.9196 -8.2201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7196 -7.3359 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.8143 -7.8412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6880 -9.0202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8249 -7.2517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8249 -6.0306 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.8776 -7.8412 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.8881 -7.2517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8881 -6.0306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9408 -5.4411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9513 -6.0306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9513 -7.2517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9408 -7.8412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0040 -7.8412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0040 -9.0202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0145 -9.6097 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.0672 -9.0202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0672 -7.8412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0145 -7.2517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1199 -9.6097 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.1304 -9.0202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1831 -9.6097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1936 -9.0202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1936 -7.8412 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.1831 -7.2517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1304 -7.8412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8776 -5.4411 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
9.7406 -8.0938 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
1 5 1 0
4 6 1 0
6 7 2 0
6 8 1 0
8 9 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
9 14 2 0
13 15 1 0
16 15 1 0
16 17 2 0
18 17 1 0
19 18 2 0
20 19 1 0
15 20 2 0
18 21 1 0
21 22 1 0
23 22 1 0
24 23 1 0
25 24 1 0
25 26 1 0
27 26 1 0
22 27 1 0
10 28 1 0
2 29 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 413.87Molecular Weight (Monoisotopic): 413.1255AlogP: 3.36#Rotatable Bonds: 5Polar Surface Area: 115.30Molecular Species: BASEHBA: 7HBD: 3#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.98CX Basic pKa: 9.82CX LogP: 2.36CX LogD: 0.00Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.59Np Likeness Score: -1.29
References 1. (2018) Oxazole derivatives for use in the treatment of cancer,