The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(3R,3aS,6aR)-Hexahydrofuro[2,3-b]furan-3-yl((2S,3R)-1-((1s,3R)-Adamantan-1-yl)-3-hydroxy-4-((N-isobutyl-4-methoxyphenyl)sulfonamido)butan-2-yl)carbamate ID: ALA4516606
PubChem CID: 121596962
Max Phase: Preclinical
Molecular Formula: C32H48N2O8S
Molecular Weight: 620.81
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](CC23CC4CC(CC(C4)C2)C3)NC(=O)O[C@H]2CO[C@H]3OCC[C@H]32)cc1
Standard InChI: InChI=1S/C32H48N2O8S/c1-20(2)17-34(43(37,38)25-6-4-24(39-3)5-7-25)18-28(35)27(16-32-13-21-10-22(14-32)12-23(11-21)15-32)33-31(36)42-29-19-41-30-26(29)8-9-40-30/h4-7,20-23,26-30,35H,8-19H2,1-3H3,(H,33,36)/t21?,22?,23?,26-,27-,28+,29-,30+,32?/m0/s1
Standard InChI Key: ZMOFGDZIKIFMEU-WWUGHDHNSA-N
Molfile:
RDKit 2D
45 50 0 0 0 0 0 0 0 0999 V2000
19.8733 -6.8148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7978 -5.8806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2443 -6.0709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4675 -5.5332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9771 -5.7137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8325 -4.8547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6142 -5.5029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4977 -4.6459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2056 -5.3495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2326 -4.2971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0460 -4.1167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.6376 -3.4041 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
21.2247 -4.1141 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.3543 -3.4084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0687 -2.9959 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.6398 -2.9959 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.3543 -4.2334 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.9253 -3.4084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1678 -3.0711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6157 -3.6842 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.7832 -3.4084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4977 -2.9959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7832 -4.2334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2121 -3.4084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4977 -2.1709 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.9266 -2.9959 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.3556 -2.9959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0690 -3.4124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7830 -3.0006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7834 -2.1747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0639 -1.7624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3529 -2.1766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7084 -2.1917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2899 -1.6065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0740 -0.8103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0876 -1.5818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4973 -1.7613 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.2124 -2.1728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8352 -4.2270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0313 -4.3964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9440 -5.2134 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.6940 -5.5489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2447 -4.9392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2293 -4.6083 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
16.6293 -4.0084 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 1 0
2 4 1 0
3 5 1 0
4 6 1 0
5 6 1 0
7 8 1 0
3 7 1 0
2 9 1 0
6 10 1 0
10 8 1 0
8 9 1 0
12 11 2 0
13 12 2 0
14 15 1 0
14 16 1 0
14 17 2 0
18 16 1 6
18 19 1 0
19 20 1 0
20 40 1 0
39 18 1 0
15 21 1 0
21 22 1 0
21 23 1 6
22 24 1 0
22 25 1 6
24 26 1 0
26 12 1 0
12 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
26 33 1 0
33 34 1 0
34 35 1 0
34 36 1 0
30 37 1 0
37 38 1 0
23 8 1 0
39 40 1 0
40 41 1 0
41 42 1 0
42 43 1 0
39 43 1 0
40 44 1 1
39 45 1 1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 620.81Molecular Weight (Monoisotopic): 620.3131AlogP: 4.17#Rotatable Bonds: 12Polar Surface Area: 123.63Molecular Species: NEUTRALHBA: 8HBD: 2#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.63CX Basic pKa: ┄CX LogP: 4.19CX LogD: 4.19Aromatic Rings: 1Heavy Atoms: 43QED Weighted: 0.36Np Likeness Score: 0.08
References 1. Ghosh AK, Osswald HL, Glauninger K, Agniswamy J, Wang YF, Hayashi H, Aoki M, Weber IT, Mitsuya H.. (2016) Probing Lipophilic Adamantyl Group as the P1-Ligand for HIV-1 Protease Inhibitors: Design, Synthesis, Protein X-ray Structural Studies, and Biological Evaluation., 59 (14): [PMID:27389367 ] [10.1021/acs.jmedchem.6b00639 ]