The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
methyl 1-(8-(2-aminophenylamino)-8-oxooctyloxy)-2-naphthoate ID: ALA4516678
PubChem CID: 155540466
Max Phase: Preclinical
Molecular Formula: C26H30N2O4
Molecular Weight: 434.54
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)c1ccc2ccccc2c1OCCCCCCCC(=O)Nc1ccccc1N
Standard InChI: InChI=1S/C26H30N2O4/c1-31-26(30)21-17-16-19-11-6-7-12-20(19)25(21)32-18-10-4-2-3-5-15-24(29)28-23-14-9-8-13-22(23)27/h6-9,11-14,16-17H,2-5,10,15,18,27H2,1H3,(H,28,29)
Standard InChI Key: FYTIFTVQBOOGKZ-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 34 0 0 0 0 0 0 0 0999 V2000
4.0556 -7.5198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0545 -8.3393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7625 -8.7483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7608 -7.1109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4694 -7.5162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4701 -8.3352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1787 -8.7423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8869 -8.3314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8822 -7.5093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1731 -7.1059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3465 -8.7473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6391 -8.3382 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.3458 -9.5645 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.6378 -9.9726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7644 -9.5655 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.4731 -9.9724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1799 -9.5622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8885 -9.9691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5953 -9.5589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3039 -9.9659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0107 -9.5556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7193 -9.9626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4261 -9.5523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1347 -9.9593 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.4242 -8.7352 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.1310 -8.3249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8390 -8.7345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5453 -8.3249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5438 -7.5069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8302 -7.1001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1268 -7.5120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4168 -7.1074 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 5 1 0
2 11 1 0
11 12 2 0
11 13 1 0
13 14 1 0
3 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 2 0
23 25 1 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
31 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 434.54Molecular Weight (Monoisotopic): 434.2206AlogP: 5.57#Rotatable Bonds: 11Polar Surface Area: 90.65Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 3.45CX LogP: 5.20CX LogD: 5.20Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.23Np Likeness Score: -0.48
References 1. Bouchet S, Linot C, Ruzic D, Agbaba D, Fouchaq B, Roche J, Nikolic K, Blanquart C, Bertrand P.. (2019) Extending Cross Metathesis To Identify Selective HDAC Inhibitors: Synthesis, Biological Activities, and Modeling., 10 (6): [PMID:31223439 ] [10.1021/acsmedchemlett.8b00440 ]