methyl 1-(8-(2-aminophenylamino)-8-oxooctyloxy)-2-naphthoate

ID: ALA4516678

PubChem CID: 155540466

Max Phase: Preclinical

Molecular Formula: C26H30N2O4

Molecular Weight: 434.54

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COC(=O)c1ccc2ccccc2c1OCCCCCCCC(=O)Nc1ccccc1N

Standard InChI:  InChI=1S/C26H30N2O4/c1-31-26(30)21-17-16-19-11-6-7-12-20(19)25(21)32-18-10-4-2-3-5-15-24(29)28-23-14-9-8-13-22(23)27/h6-9,11-14,16-17H,2-5,10,15,18,27H2,1H3,(H,28,29)

Standard InChI Key:  FYTIFTVQBOOGKZ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 34  0  0  0  0  0  0  0  0999 V2000
    4.0556   -7.5198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0545   -8.3393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7625   -8.7483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7608   -7.1109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4694   -7.5162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4701   -8.3352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1787   -8.7423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8869   -8.3314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8822   -7.5093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1731   -7.1059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3465   -8.7473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6391   -8.3382    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.3458   -9.5645    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.6378   -9.9726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7644   -9.5655    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.4731   -9.9724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1799   -9.5622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8885   -9.9691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5953   -9.5589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3039   -9.9659    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0107   -9.5556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7193   -9.9626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4261   -9.5523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1347   -9.9593    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.4242   -8.7352    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.1310   -8.3249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8390   -8.7345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5453   -8.3249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5438   -7.5069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8302   -7.1001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1268   -7.5120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4168   -7.1074    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  5  1  0
  2 11  1  0
 11 12  2  0
 11 13  1  0
 13 14  1  0
  3 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  2  0
 23 25  1  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 26  1  0
 31 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4516678

    ---

Associated Targets(Human)

HDAC1 Tclin Histone deacetylase (6747 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 434.54Molecular Weight (Monoisotopic): 434.2206AlogP: 5.57#Rotatable Bonds: 11
Polar Surface Area: 90.65Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 3.45CX LogP: 5.20CX LogD: 5.20
Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.23Np Likeness Score: -0.48

References

1. Bouchet S, Linot C, Ruzic D, Agbaba D, Fouchaq B, Roche J, Nikolic K, Blanquart C, Bertrand P..  (2019)  Extending Cross Metathesis To Identify Selective HDAC Inhibitors: Synthesis, Biological Activities, and Modeling.,  10  (6): [PMID:31223439] [10.1021/acsmedchemlett.8b00440]

Source