1-((5-Bromo-4-((4-bromonaphth-1-yl)methyl)-4H-1,2,4-triazol-3-yl)thio)-N-(5-(trifluoromethyl)pyridin-3-yl)methanesulfonamide

ID: ALA4516802

PubChem CID: 155540397

Max Phase: Preclinical

Molecular Formula: C20H14Br2F3N5O2S2

Molecular Weight: 637.30

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=S(=O)(CSc1nnc(Br)n1Cc1ccc(Br)c2ccccc12)Nc1cncc(C(F)(F)F)c1

Standard InChI:  InChI=1S/C20H14Br2F3N5O2S2/c21-17-6-5-12(15-3-1-2-4-16(15)17)10-30-18(22)27-28-19(30)33-11-34(31,32)29-14-7-13(8-26-9-14)20(23,24)25/h1-9,29H,10-11H2

Standard InChI Key:  OAYABYPCLYZEDN-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 34 37  0  0  0  0  0  0  0  0999 V2000
   29.3116   -9.6660    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.7243  -10.3759    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   30.1327   -9.6635    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.3988  -12.8468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6853  -13.2589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6849  -14.0795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3973  -14.4889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.1084  -13.2567    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.1109  -14.0721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8136  -14.4737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.5184  -14.0653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.5119  -13.2468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8045  -12.8447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3988  -12.0255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6869  -11.6169    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.5985  -10.8020    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7951  -10.6321    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.3823  -11.3440    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.9333  -11.9512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3045  -10.3841    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   29.0201  -10.7904    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7638  -12.7547    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
   28.4002  -15.3102    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
   30.4354  -10.7801    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.1404  -10.3668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.8472  -10.7724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.5517  -10.3598    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.5467   -9.5417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.8313   -9.1380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.1298   -9.5530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.8230   -8.3209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.5265   -7.9051    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   31.1112   -7.9195    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   31.8168   -7.5033    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  9  1  0
  8  4  1  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13  8  2  0
  4 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 15  1  0
 16 20  1  0
 20 21  1  0
 19 22  1  0
  7 23  1  0
 21  2  1  0
  2 24  1  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 25  1  0
 29 31  1  0
 31 32  1  0
 31 33  1  0
 31 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4516802

    ---

Associated Targets(Human)

SLC22A12 Tclin Solute carrier family 22 member 12 (799 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 637.30Molecular Weight (Monoisotopic): 634.8908AlogP: 5.91#Rotatable Bonds: 7
Polar Surface Area: 89.77Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: 8.13CX Basic pKa: 2.25CX LogP: 4.61CX LogD: 4.54
Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.25Np Likeness Score: -1.75

References

1. Wu JW, Yin L, Liu YQ, Zhang H, Xie YF, Wang RL, Zhao GL..  (2019)  Synthesis, biological evaluation and 3D-QSAR studies of 1,2,4-triazole-5-substituted carboxylic acid bioisosteres as uric acid transporter 1 (URAT1) inhibitors for the treatment of hyperuricemia associated with gout.,  29  (3): [PMID:30579795] [10.1016/j.bmcl.2018.12.036]

Source