N-(4-(3-((2-Hydroxy-2-(8-hydroxy-2-oxo-1,2-dihydroquinolin-5-yl)ethyl)amino)propyl)phenyl)-3,5,5-trimethylhexanamide

ID: ALA4516838

PubChem CID: 155540608

Max Phase: Preclinical

Molecular Formula: C29H39N3O4

Molecular Weight: 493.65

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(CC(=O)Nc1ccc(CCCNCC(O)c2ccc(O)c3[nH]c(=O)ccc23)cc1)CC(C)(C)C

Standard InChI:  InChI=1S/C29H39N3O4/c1-19(17-29(2,3)4)16-27(36)31-21-9-7-20(8-10-21)6-5-15-30-18-25(34)22-11-13-24(33)28-23(22)12-14-26(35)32-28/h7-14,19,25,30,33-34H,5-6,15-18H2,1-4H3,(H,31,36)(H,32,35)

Standard InChI Key:  BPDXUFOLKSRLPV-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 36 38  0  0  0  0  0  0  0  0999 V2000
   16.1195   -9.8517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1184  -10.6712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5333   -9.8481    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8246   -9.4428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5361  -10.6707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8230  -11.0773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8185  -11.8936    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.5255  -12.3096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2386  -11.9030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2448  -11.0805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5199  -13.1268    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.4106  -11.0796    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.2394   -9.4368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9487   -9.8427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2364   -8.6196    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.6548   -9.4315    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.3641   -9.8374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0702   -9.4261    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7795   -9.8321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4857   -9.4208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1921   -9.8289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8977   -9.4183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8951   -8.6002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1809   -8.1945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4781   -8.6074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6007   -8.1880    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.3105   -8.5930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0161   -8.1808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3147   -9.4102    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.7259   -8.5858    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4315   -8.1736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1413   -8.5786    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8469   -8.1664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7301   -9.4030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1455   -9.3958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8452   -8.9850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  6  1  0
  5  3  1  0
  3  4  2  0
  4  1  1  0
  5  6  2  0
  5 10  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  2  0
  8 11  2  0
  2 12  1  0
  3 13  1  0
 13 14  1  0
 13 15  1  0
 14 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
 23 26  1  0
 26 27  1  0
 27 28  1  0
 27 29  2  0
 28 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 30 34  1  0
 32 35  1  0
 32 36  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4516838

    ---

Associated Targets(Human)

ADRB2 Tclin Beta-2 adrenergic receptor (11824 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 493.65Molecular Weight (Monoisotopic): 493.2941AlogP: 4.89#Rotatable Bonds: 11
Polar Surface Area: 114.45Molecular Species: BASEHBA: 5HBD: 5
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 5#RO5 Violations (Lipinski):
CX Acidic pKa: 8.51CX Basic pKa: 9.76CX LogP: 3.82CX LogD: 2.87
Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.24Np Likeness Score: -0.22

References

1. Xing G, Pan L, Yi C, Li X, Ge X, Zhao Y, Liu Y, Li J, Woo A, Lin B, Zhang Y, Cheng M..  (2019)  Design, synthesis and biological evaluation of 5-(2-amino-1-hydroxyethyl)-8-hydroxyquinolin-2(1H)-one derivatives as potent β2-adrenoceptor agonists.,  27  (12): [PMID:30392952] [10.1016/j.bmc.2018.10.043]

Source