The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(4-(3-((2-Hydroxy-2-(8-hydroxy-2-oxo-1,2-dihydroquinolin-5-yl)ethyl)amino)propyl)phenyl)-3,5,5-trimethylhexanamide ID: ALA4516838
PubChem CID: 155540608
Max Phase: Preclinical
Molecular Formula: C29H39N3O4
Molecular Weight: 493.65
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC(CC(=O)Nc1ccc(CCCNCC(O)c2ccc(O)c3[nH]c(=O)ccc23)cc1)CC(C)(C)C
Standard InChI: InChI=1S/C29H39N3O4/c1-19(17-29(2,3)4)16-27(36)31-21-9-7-20(8-10-21)6-5-15-30-18-25(34)22-11-13-24(33)28-23(22)12-14-26(35)32-28/h7-14,19,25,30,33-34H,5-6,15-18H2,1-4H3,(H,31,36)(H,32,35)
Standard InChI Key: BPDXUFOLKSRLPV-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 38 0 0 0 0 0 0 0 0999 V2000
16.1195 -9.8517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1184 -10.6712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5333 -9.8481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8246 -9.4428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5361 -10.6707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8230 -11.0773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8185 -11.8936 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.5255 -12.3096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2386 -11.9030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2448 -11.0805 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5199 -13.1268 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.4106 -11.0796 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.2394 -9.4368 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9487 -9.8427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2364 -8.6196 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.6548 -9.4315 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.3641 -9.8374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0702 -9.4261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7795 -9.8321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4857 -9.4208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1921 -9.8289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8977 -9.4183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8951 -8.6002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1809 -8.1945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4781 -8.6074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6007 -8.1880 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.3105 -8.5930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0161 -8.1808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3147 -9.4102 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.7259 -8.5858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4315 -8.1736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1413 -8.5786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8469 -8.1664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7301 -9.4030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1455 -9.3958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8452 -8.9850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 6 1 0
5 3 1 0
3 4 2 0
4 1 1 0
5 6 2 0
5 10 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 2 0
8 11 2 0
2 12 1 0
3 13 1 0
13 14 1 0
13 15 1 0
14 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
23 26 1 0
26 27 1 0
27 28 1 0
27 29 2 0
28 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
30 34 1 0
32 35 1 0
32 36 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 493.65Molecular Weight (Monoisotopic): 493.2941AlogP: 4.89#Rotatable Bonds: 11Polar Surface Area: 114.45Molecular Species: BASEHBA: 5HBD: 5#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 5#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.51CX Basic pKa: 9.76CX LogP: 3.82CX LogD: 2.87Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.24Np Likeness Score: -0.22
References 1. Xing G, Pan L, Yi C, Li X, Ge X, Zhao Y, Liu Y, Li J, Woo A, Lin B, Zhang Y, Cheng M.. (2019) Design, synthesis and biological evaluation of 5-(2-amino-1-hydroxyethyl)-8-hydroxyquinolin-2(1H)-one derivatives as potent β2 -adrenoceptor agonists., 27 (12): [PMID:30392952 ] [10.1016/j.bmc.2018.10.043 ]