1-(((2R,4S)-2-(4-chlorophenethyl)-4-(tosylmethyl)-1,3-dioxolan-2-yl)methyl)-1H-imidazole

ID: ALA4516867

PubChem CID: 155540409

Max Phase: Preclinical

Molecular Formula: C23H25ClN2O4S

Molecular Weight: 460.98

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1ccc(S(=O)(=O)C[C@@H]2CO[C@@](CCc3ccc(Cl)cc3)(Cn3ccnc3)O2)cc1

Standard InChI:  InChI=1S/C23H25ClN2O4S/c1-18-2-8-22(9-3-18)31(27,28)15-21-14-29-23(30-21,16-26-13-12-25-17-26)11-10-19-4-6-20(24)7-5-19/h2-9,12-13,17,21H,10-11,14-16H2,1H3/t21-,23+/m0/s1

Standard InChI Key:  KSLIHKHOUUSDEP-JTHBVZDNSA-N

Molfile:  

 
     RDKit          2D

 31 34  0  0  0  0  0  0  0  0999 V2000
   24.5157   -3.8342    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.3329   -3.8342    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   24.9243   -3.1265    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.2268   -6.3229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9366   -6.7279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6422   -6.3157    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.3878   -6.6419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9315   -6.0318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5193   -5.3261    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.7209   -5.5002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.5212   -6.7351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.8114   -6.3301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1058   -6.7423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8898   -5.8450    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.6354   -5.0641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8182   -5.0641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.5639   -5.8450    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.3412   -4.6514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0420   -3.4217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7518   -3.8284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4567   -3.4166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4526   -2.5985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7376   -2.1941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0356   -2.6083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3989   -6.3353    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6937   -6.7468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6974   -7.5649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4122   -7.9697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1144   -7.5558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9924   -7.9780    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   28.1574   -2.1850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  6  1  0
  4 11  1  1
 11 12  1  0
 12 13  1  0
 16 17  1  0
 14 15  1  0
  4 14  1  0
 15 16  1  0
 17  4  1  0
 15 18  1  1
 18  2  1  0
  2 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 19  1  0
 13 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 13  1  0
 27 30  1  0
 22 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4516867

    ---

Associated Targets(non-human)

Hmox1 Heme oxygenase 1 (289 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Hmox2 Heme oxygenase 2 (264 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 460.98Molecular Weight (Monoisotopic): 460.1224AlogP: 4.06#Rotatable Bonds: 8
Polar Surface Area: 70.42Molecular Species: NEUTRALHBA: 6HBD:
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: 13.52CX Basic pKa: 6.43CX LogP: 4.57CX LogD: 4.54
Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.51Np Likeness Score: -0.81

References

1. Intagliata S, Salerno L, Ciaffaglione V, Leonardi C, Fallica AN, Carota G, Amata E, Marrazzo A, Pittalà V, Romeo G..  (2019)  Heme Oxygenase-2 (HO-2) as a therapeutic target: Activators and inhibitors.,  183  [PMID:31550661] [10.1016/j.ejmech.2019.111703]

Source