The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Calcium(I) 2-((4-(Benzo[d]thiazol-5-ylamino)-6-(tertbutylsulfonyl)quinazolin-7-yl)oxy)ethyl Hydrogen Phosphate Trihydrate ID: ALA4516875
PubChem CID: 155540443
Max Phase: Preclinical
Molecular Formula: C21H25CaN4O7PS2
Molecular Weight: 538.54
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)(C)S(=O)(=O)c1cc2c(Nc3ccc4scnc4c3)ncnc2cc1OCCOP(=O)(O)O.[CaH2]
Standard InChI: InChI=1S/C21H23N4O7PS2.Ca.2H/c1-21(2,3)35(29,30)19-9-14-15(10-17(19)31-6-7-32-33(26,27)28)22-11-23-20(14)25-13-4-5-18-16(8-13)24-12-34-18;;;/h4-5,8-12H,6-7H2,1-3H3,(H,22,23,25)(H2,26,27,28);;;
Standard InChI Key: MYFZETQANMBAMR-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 38 0 0 0 0 0 0 0 0999 V2000
40.6902 -8.8393 0.0000 Ca 0 0 0 0 0 2 0 0 0 0 0 0
39.6675 -9.2627 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.2592 -8.5502 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
38.8464 -9.2601 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.2759 -3.7084 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.6926 -4.4251 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
41.1049 -3.7059 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
41.4079 -4.8376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.4066 -5.6649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.1215 -6.0779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.1197 -4.4248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.8351 -4.8340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.8359 -5.6608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.5512 -6.0718 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
44.2663 -5.6570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.2614 -4.8270 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
43.5455 -4.4197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.5412 -3.5948 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
44.2535 -3.1785 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.9789 -4.8379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.2643 -4.4256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.6919 -6.0769 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.6913 -6.9019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.9791 -5.6629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.2592 -5.2460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.9764 -7.3139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.9758 -8.1389 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
44.9655 -3.5906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.9517 -1.9406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.2429 -2.3586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.6734 -2.3491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.6772 -3.1735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.4625 -3.4247 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
46.9441 -2.7554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.4564 -2.0908 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
38.5468 -8.1377 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3 2 1 0
4 3 1 0
6 5 2 0
7 6 2 0
8 9 2 0
9 10 1 0
10 13 2 0
12 11 2 0
11 8 1 0
12 13 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
17 18 1 0
18 19 1 0
8 6 1 0
6 20 1 0
20 21 1 0
9 22 1 0
22 23 1 0
20 24 1 0
20 25 1 0
23 26 1 0
26 27 1 0
19 28 2 0
28 32 1 0
31 29 1 0
29 30 2 0
30 19 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 35 1 0
35 31 1 0
27 3 1 0
3 36 2 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 538.54Molecular Weight (Monoisotopic): 538.0746AlogP: 4.04#Rotatable Bonds: 8Polar Surface Area: 160.83Molecular Species: ACIDHBA: 10HBD: 3#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 1.03CX Basic pKa: 4.17CX LogP: 0.62CX LogD: -0.58Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.22Np Likeness Score: -0.97
References 1. Haile PA, Casillas LN, Votta BJ, Wang GZ, Charnley AK, Dong X, Bury MJ, Romano JJ, Mehlmann JF, King BW, Erhard KF, Hanning CR, Lipshutz DB, Desai BM, Capriotti CA, Schaeffer MC, Berger SB, Mahajan MK, Reilly MA, Nagilla R, Rivera EJ, Sun HH, Kenna JK, Beal AM, Ouellette MT, Kelly M, Stemp G, Convery MA, Vossenkämper A, MacDonald TT, Gough PJ, Bertin J, Marquis RW.. (2019) Discovery of a First-in-Class Receptor Interacting Protein 2 (RIP2) Kinase Specific Clinical Candidate, 2-((4-(Benzo[d]thiazol-5-ylamino)-6-(tert-butylsulfonyl)quinazolin-7-yl)oxy)ethyl Dihydrogen Phosphate, for the Treatment of Inflammatory Diseases., 62 (14): [PMID:31265286 ] [10.1021/acs.jmedchem.9b00575 ]