The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5,6-Dimethyl-2-nitro-8-((3-(trifluoromethoxy)benzyl)oxy)imidazo[1,2-a]pyrazine ID: ALA4516883
PubChem CID: 155540509
Max Phase: Preclinical
Molecular Formula: C16H13F3N4O4
Molecular Weight: 382.30
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1nc(OCc2cccc(OC(F)(F)F)c2)c2nc([N+](=O)[O-])cn2c1C
Standard InChI: InChI=1S/C16H13F3N4O4/c1-9-10(2)22-7-13(23(24)25)21-14(22)15(20-9)26-8-11-4-3-5-12(6-11)27-16(17,18)19/h3-7H,8H2,1-2H3
Standard InChI Key: NQLBYQGEPWGTEO-UHFFFAOYSA-N
Molfile:
RDKit 2D
27 29 0 0 0 0 0 0 0 0999 V2000
26.6201 -3.8920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3296 -3.4834 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.3296 -2.6621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6201 -2.2493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9149 -3.4834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9062 -2.6621 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.1277 -2.4139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6469 -3.0817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1350 -3.7442 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.8207 -3.0876 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.4119 -3.8017 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.4041 -2.3780 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.6201 -4.7133 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.0389 -2.2576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3320 -5.1219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0438 -4.7133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7556 -5.1242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4669 -4.7163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4673 -3.8941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7505 -3.4815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0421 -3.8959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6213 -1.4280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1785 -5.1252 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.1781 -5.9465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8898 -6.3596 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
29.4661 -6.3589 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
30.1700 -6.7645 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
6 4 1 0
5 1 1 0
1 2 2 0
2 3 1 0
3 4 2 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 5 2 0
10 11 2 0
10 12 1 0
8 10 1 0
1 13 1 0
3 14 1 0
13 15 1 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
4 22 1 0
18 23 1 0
23 24 1 0
24 25 1 0
24 26 1 0
24 27 1 0
M CHG 2 10 1 12 -1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 382.30Molecular Weight (Monoisotopic): 382.0889AlogP: 3.73#Rotatable Bonds: 5Polar Surface Area: 91.79Molecular Species: NEUTRALHBA: 7HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 4.00CX LogD: 4.00Aromatic Rings: 3Heavy Atoms: 27QED Weighted: 0.49Np Likeness Score: -1.42
References 1. Jarrad AM, Ang CW, Debnath A, Hahn HJ, Woods K, Tan L, Sykes ML, Jones AJ, Pelingon R, Butler MS, Avery VM, West NP, Karoli T, Blaskovich MAT, Cooper MA.. (2018) Design, Synthesis, and Biological Evaluation of 2-Nitroimidazopyrazin-one/-es with Antitubercular and Antiparasitic Activity., 61 (24): [PMID:30468386 ] [10.1021/acs.jmedchem.8b01578 ]