The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-Adamantan-1-yl-N-{2-[2-(2-{2-[2-(2,6-dioxo-piperidin-3-yl)-1,3-dioxo-2,3-dihydro-1H-isoindol-4-ylamino]-ethoxy}-ethoxy)-ethoxy]-ethyl}-acetamide ID: ALA4516967
PubChem CID: 155540419
Max Phase: Preclinical
Molecular Formula: C33H44N4O8
Molecular Weight: 624.74
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(CC12CC3CC(CC(C3)C1)C2)NCCOCCOCCOCCNc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O
Standard InChI: InChI=1S/C33H44N4O8/c38-27-5-4-26(30(40)36-27)37-31(41)24-2-1-3-25(29(24)32(37)42)34-6-8-43-10-12-45-13-11-44-9-7-35-28(39)20-33-17-21-14-22(18-33)16-23(15-21)19-33/h1-3,21-23,26,34H,4-20H2,(H,35,39)(H,36,38,40)
Standard InChI Key: HIGNLENJNGHQRT-UHFFFAOYSA-N
Molfile:
RDKit 2D
45 50 0 0 0 0 0 0 0 0999 V2000
2.4024 -14.5864 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0417 -13.9092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1992 -14.3635 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7422 -14.1694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9530 -14.6634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4871 -13.9856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1966 -13.5190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7479 -12.8591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0372 -13.1172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4970 -13.1703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1955 -13.5670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9107 -13.9738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6191 -13.5552 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.9175 -14.7951 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.3343 -13.9620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0427 -13.5434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7579 -13.9502 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.4622 -13.5316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1774 -13.9384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8858 -13.5198 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.6010 -13.9267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3094 -13.5080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0247 -13.9149 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.7331 -13.4963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4483 -13.9031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1526 -13.4845 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.1457 -12.6632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8601 -12.2590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8603 -11.4385 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1478 -11.0251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4370 -12.2615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4307 -11.4448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6559 -11.1954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1791 -11.8607 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.6661 -12.5186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3933 -10.4161 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.3578 -11.8671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9449 -11.1578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1272 -11.1622 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.7202 -11.8754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1331 -12.5859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9570 -12.5831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8989 -11.8787 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.3551 -10.4446 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.4154 -13.3018 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 1 0
2 4 1 0
3 5 1 0
4 6 1 0
5 6 1 0
7 8 1 0
3 7 1 0
2 9 1 0
6 10 1 0
10 8 1 0
8 9 1 0
6 11 1 0
11 12 1 0
12 13 1 0
12 14 2 0
13 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 32 1 0
31 27 1 0
31 32 2 0
32 33 1 0
33 34 1 0
34 35 1 0
35 31 1 0
33 36 2 0
34 37 1 0
37 38 1 0
37 42 1 0
38 39 1 0
39 40 1 0
40 41 1 0
41 42 1 0
40 43 2 0
38 44 2 0
35 45 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 624.74Molecular Weight (Monoisotopic): 624.3159AlogP: 2.27#Rotatable Bonds: 16Polar Surface Area: 152.37Molecular Species: NEUTRALHBA: 9HBD: 3#RO5 Violations: 1HBA (Lipinski): 12HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.59CX Basic pKa: 1.29CX LogP: 1.56CX LogD: 1.56Aromatic Rings: 1Heavy Atoms: 45QED Weighted: 0.19Np Likeness Score: -0.64
References 1. Steinebach C, Sosič I, Lindner S, Bricelj A, Kohl F, Ng YLD, Monschke M, Wagner KG, Krönke J, Gütschow M.. (2019) A MedChem toolbox for cereblon-directed PROTACs., 10 (6): [PMID:31304001 ] [10.1039/C9MD00185A ] 2. Matyskiela, Mary E ME and 18 more authors. 2018-01-25 A Cereblon Modulator (CC-220) with Improved Degradation of Ikaros and Aiolos. [PMID:28425720 ]