The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-N4-(tert-butoxy)-N1-((S)-3-(4-fluorophenyl)-1-((naphthalen-1-ylmethyl)amino)-1-oxopropan-2-yl)-2-(3-phenylpropanamido)succinamide ID: ALA4516988
PubChem CID: 91824176
Max Phase: Preclinical
Molecular Formula: C37H41FN4O5
Molecular Weight: 640.76
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)(C)ONC(=O)C[C@H](NC(=O)CCc1ccccc1)C(=O)N[C@@H](Cc1ccc(F)cc1)C(=O)NCc1cccc2ccccc12
Standard InChI: InChI=1S/C37H41FN4O5/c1-37(2,3)47-42-34(44)23-32(40-33(43)21-18-25-10-5-4-6-11-25)36(46)41-31(22-26-16-19-29(38)20-17-26)35(45)39-24-28-14-9-13-27-12-7-8-15-30(27)28/h4-17,19-20,31-32H,18,21-24H2,1-3H3,(H,39,45)(H,40,43)(H,41,46)(H,42,44)/t31-,32-/m0/s1
Standard InChI Key: DDEQIWLWJUDFKG-ACHIHNKUSA-N
Molfile:
RDKit 2D
47 50 0 0 0 0 0 0 0 0999 V2000
7.7014 -22.6090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4132 -22.2004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1251 -22.6090 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.4132 -21.3790 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.9896 -22.2004 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.9896 -21.3790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2777 -20.9663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7014 -20.9663 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.2777 -20.1450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5700 -19.7364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5752 -18.9140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8642 -18.5014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1514 -18.9142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1540 -19.7397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8656 -20.1445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7014 -23.4303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9896 -23.8430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9896 -24.6643 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.2777 -23.4303 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.5700 -23.8430 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.8582 -23.4303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1464 -23.8430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8582 -22.6090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1437 -23.0176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8369 -22.2004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5488 -22.6090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2606 -22.2004 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.5488 -23.4303 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.9683 -22.6090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6801 -22.2004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1027 -21.3829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3859 -20.9703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6774 -21.3847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1022 -22.2051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3921 -22.6116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3921 -23.4286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1016 -23.8400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8125 -23.4244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8089 -22.6087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8369 -21.3790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5488 -20.9663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2604 -21.3816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9676 -20.9695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9680 -20.1473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2553 -19.7389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5469 -20.1492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6793 -19.7378 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
2 4 2 0
1 5 1 0
5 6 1 0
6 7 1 0
6 8 2 0
7 9 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
1 16 1 6
16 17 1 0
17 18 2 0
17 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
21 23 1 0
21 24 1 0
3 25 1 0
25 26 1 0
26 27 1 0
26 28 2 0
27 29 1 0
29 30 1 0
30 35 2 0
34 31 2 0
31 32 1 0
32 33 2 0
33 30 1 0
34 35 1 0
35 36 1 0
36 37 2 0
37 38 1 0
38 39 2 0
39 34 1 0
25 40 1 1
40 41 1 0
41 42 2 0
42 43 1 0
43 44 2 0
44 45 1 0
45 46 2 0
46 41 1 0
44 47 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 640.76Molecular Weight (Monoisotopic): 640.3061AlogP: 4.68#Rotatable Bonds: 14Polar Surface Area: 125.63Molecular Species: NEUTRALHBA: 5HBD: 4#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 8.41CX Basic pKa: ┄CX LogP: 4.89CX LogD: 4.86Aromatic Rings: 4Heavy Atoms: 47QED Weighted: 0.15Np Likeness Score: -0.56
References 1. Schiffrer ES, Sosič I, Šterman A, Mravljak J, Raščan IM, Gobec S, Gobec M.. (2019) A focused structure-activity relationship study of psoralen-based immunoproteasome inhibitors., 10 (11): [PMID:32952997 ] [10.1039/C9MD00365G ] 2. Zhan W,Singh PK,Ban Y,Qing X,Ah Kioon MD,Fan H,Zhao Q,Wang R,Sukenick G,Salmon J,Warren JD,Ma X,Barrat FJ,Nathan CF,Lin G. (2020) Structure-Activity Relationships of Noncovalent Immunoproteasome β5i-Selective Dipeptides., 63 (21): [PMID:33095579 ] [10.1021/acs.jmedchem.0c01520 ]