1-((5-Bromo-4-((4-bromonaphth-1-yl)methyl)-4H-1,2,4-triazol-3-yl)thio)-N-phenylmethanesulfonamide

ID: ALA4517057

PubChem CID: 155540831

Max Phase: Preclinical

Molecular Formula: C20H16Br2N4O2S2

Molecular Weight: 568.32

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=S(=O)(CSc1nnc(Br)n1Cc1ccc(Br)c2ccccc12)Nc1ccccc1

Standard InChI:  InChI=1S/C20H16Br2N4O2S2/c21-18-11-10-14(16-8-4-5-9-17(16)18)12-26-19(22)23-24-20(26)29-13-30(27,28)25-15-6-2-1-3-7-15/h1-11,25H,12-13H2

Standard InChI Key:  WGLQIWMKOPOYRY-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
    4.6885  -10.1200    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.1013  -10.8298    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    5.5097  -10.1175    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.7757  -13.3008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0623  -13.7129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0619  -14.5335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7743  -14.9429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4853  -13.7107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4879  -14.5261    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1906  -14.9277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8953  -14.5192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8888  -13.7008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1815  -13.2987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7757  -12.4795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0639  -12.0709    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.9755  -11.2560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1720  -11.0861    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.7593  -11.7980    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.3103  -12.4052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6815  -10.8381    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    4.3970  -11.2444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1407  -13.2087    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
    3.7772  -15.7642    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
    5.8124  -11.2341    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.5174  -10.8208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2242  -11.2264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9287  -10.8138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9237   -9.9957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2083   -9.5920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5067  -10.0070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  9  1  0
  8  4  1  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13  8  2  0
  4 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 15  1  0
 16 20  1  0
 20 21  1  0
 19 22  1  0
  7 23  1  0
 21  2  1  0
  2 24  1  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 25  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4517057

    ---

Associated Targets(Human)

SLC22A12 Tclin Solute carrier family 22 member 12 (799 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 568.32Molecular Weight (Monoisotopic): 565.9081AlogP: 5.50#Rotatable Bonds: 7
Polar Surface Area: 76.88Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: 9.13CX Basic pKa: CX LogP: 4.95CX LogD: 4.94
Aromatic Rings: 4Heavy Atoms: 30QED Weighted: 0.30Np Likeness Score: -1.58

References

1. Wu JW, Yin L, Liu YQ, Zhang H, Xie YF, Wang RL, Zhao GL..  (2019)  Synthesis, biological evaluation and 3D-QSAR studies of 1,2,4-triazole-5-substituted carboxylic acid bioisosteres as uric acid transporter 1 (URAT1) inhibitors for the treatment of hyperuricemia associated with gout.,  29  (3): [PMID:30579795] [10.1016/j.bmcl.2018.12.036]

Source