The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
NA ID: ALA4517096
PubChem CID: 155540387
Max Phase: Preclinical
Molecular Formula: C26H26N4O2
Molecular Weight: 426.52
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cnc(C(C)(C)C#Cc2ccc3c(c2)-c2nc(C(N)=O)c(C4CC4)n2C2CC3C2)o1
Standard InChI: InChI=1S/C26H26N4O2/c1-14-13-28-25(32-14)26(2,3)9-8-15-4-7-19-17-11-18(12-17)30-22(16-5-6-16)21(23(27)31)29-24(30)20(19)10-15/h4,7,10,13,16-18H,5-6,11-12H2,1-3H3,(H2,27,31)
Standard InChI Key: IAXMTTOIYPZWFX-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 37 0 0 0 0 0 0 0 0999 V2000
17.2103 -20.9908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7192 -21.6419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5452 -21.6478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8864 -20.2054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0674 -21.0106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8538 -21.2549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4599 -20.6951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2742 -19.8876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4881 -19.6470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4035 -20.1833 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.1477 -19.8403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0514 -19.0264 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.2476 -18.8666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8473 -19.5816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9022 -18.1174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3783 -17.4436 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.0806 -18.0419 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.0881 -20.8716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8779 -19.3253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4846 -18.7602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0883 -18.1980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6654 -17.5002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5249 -17.4966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7788 -18.6381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8331 -19.4552 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.6258 -19.6604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0660 -18.9699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5453 -18.3380 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.8895 -18.9197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0293 -19.6826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2713 -19.3570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3683 -20.1763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11 4 1 0
10 1 1 0
1 2 1 0
5 3 1 0
2 3 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 10 1 0
13 15 1 0
15 16 1 0
15 17 2 0
1 18 1 0
18 3 1 0
8 19 1 0
19 20 3 0
20 21 1 0
21 22 1 0
21 23 1 0
21 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 24 1 0
27 29 1 0
31 30 1 0
32 31 1 0
30 32 1 0
14 30 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 426.52Molecular Weight (Monoisotopic): 426.2056AlogP: 4.58#Rotatable Bonds: 3Polar Surface Area: 86.94Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 3.05CX LogP: 3.99CX LogD: 3.99Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.62Np Likeness Score: -0.57
References 1. Feng JA, Lee P, Alaoui MH, Barrett K, Castanedo G, Godemann R, McEwan P, Wang X, Wu P, Zhang Y, Harris SF, Staben ST.. (2019) Structure Based Design of Potent Selective Inhibitors of Protein Kinase D1 (PKD1)., 10 (9): [PMID:31531194 ] [10.1021/acsmedchemlett.8b00658 ]