The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
11-Demethylpiericidin A ID: ALA4517191
PubChem CID: 155541032
Max Phase: Preclinical
Molecular Formula: C24H35NO4
Molecular Weight: 401.55
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C/C=C/[C@H](O)[C@H](C)/C=C(C)/C=C/C/C(C)=C/Cc1nc(OC)c(OC)c(O)c1C
Standard InChI: InChI=1S/C24H35NO4/c1-8-10-21(26)18(4)15-17(3)12-9-11-16(2)13-14-20-19(5)22(27)23(28-6)24(25-20)29-7/h8-10,12-13,15,18,21,26H,11,14H2,1-7H3,(H,25,27)/b10-8+,12-9+,16-13+,17-15+/t18-,21+/m1/s1
Standard InChI Key: WFEFGXNOSOLREF-CFLFHXAXSA-N
Molfile:
RDKit 2D
29 29 0 0 0 0 0 0 0 0999 V2000
19.8309 -3.7487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8297 -4.5760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5445 -4.9889 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.2609 -4.5755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2580 -3.7450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5427 -3.3359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5403 -2.5109 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.9710 -3.3298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9760 -4.9868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6898 -4.5732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4049 -4.9846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1187 -4.5710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8338 -4.9824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5476 -4.5688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2626 -4.9801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2640 -5.8051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9765 -4.5665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6916 -4.9779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4054 -4.5643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1205 -4.9756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8342 -4.5620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4040 -3.7393 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.6928 -5.8028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4062 -5.8096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1149 -4.9879 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.1143 -5.8128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1163 -3.3363 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.1161 -2.5113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5494 -4.9734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
6 7 1 0
5 8 1 0
4 9 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 1 0
15 17 2 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 2 0
19 22 1 1
18 23 1 6
11 24 1 0
2 25 1 0
25 26 1 0
1 27 1 0
27 28 1 0
21 29 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 401.55Molecular Weight (Monoisotopic): 401.2566AlogP: 5.07#Rotatable Bonds: 10Polar Surface Area: 71.81Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 10.91CX Basic pKa: 1.94CX LogP: 5.14CX LogD: 5.14Aromatic Rings: 1Heavy Atoms: 29QED Weighted: 0.42Np Likeness Score: 1.71
References 1. Zhou X, Liang Z, Li K, Fang W, Tian Y, Luo X, Chen Y, Zhan Z, Zhang T, Liao S, Liu S, Liu Y, Fenical W, Tang L.. (2019) Exploring the Natural Piericidins as Anti-Renal Cell Carcinoma Agents Targeting Peroxiredoxin 1., 62 (15): [PMID:31298537 ] [10.1021/acs.jmedchem.9b00598 ]