7-(2-(2-Aminoethyl)phenyl)-4-methylquinolin-2-amine Dihydrochloride

ID: ALA4517228

PubChem CID: 155541002

Max Phase: Preclinical

Molecular Formula: C18H21Cl2N3

Molecular Weight: 277.37

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1cc(N)nc2cc(-c3ccccc3CCN)ccc12.Cl.Cl

Standard InChI:  InChI=1S/C18H19N3.2ClH/c1-12-10-18(20)21-17-11-14(6-7-15(12)17)16-5-3-2-4-13(16)8-9-19;;/h2-7,10-11H,8-9,19H2,1H3,(H2,20,21);2*1H

Standard InChI Key:  FUNKEQFSAWETDV-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 23 23  0  0  0  0  0  0  0  0999 V2000
   16.1994  -29.1011    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   14.6874  -26.3276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6862  -27.1512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3984  -27.5643    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.3966  -25.9187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1094  -26.3240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1101  -27.1471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8228  -27.5583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5352  -27.1433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5305  -26.3171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8172  -25.9137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9741  -27.5634    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.3942  -25.1015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2409  -27.5451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2435  -28.3634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9523  -28.7685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6590  -28.3565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6525  -27.5351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9431  -27.1337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9370  -26.3165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6416  -25.9026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6354  -25.0854    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.1316  -28.8246    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  2  3  2  0
  3  4  1  0
  4  7  2  0
  6  5  2  0
  5  2  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11  6  1  0
  3 12  1  0
  5 13  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
  9 14  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
M  END

Associated Targets(non-human)

Nos1 Nitric-oxide synthase, brain (2987 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 277.37Molecular Weight (Monoisotopic): 277.1579AlogP: 3.29#Rotatable Bonds: 3
Polar Surface Area: 64.93Molecular Species: BASEHBA: 3HBD: 2
#RO5 Violations: HBA (Lipinski): 3HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 9.75CX LogP: 3.47CX LogD: 1.10
Aromatic Rings: 3Heavy Atoms: 21QED Weighted: 0.77Np Likeness Score: -0.03

References

1. Cinelli MA, Reidl CT, Li H, Chreifi G, Poulos TL, Silverman RB..  (2020)  First Contact: 7-Phenyl-2-Aminoquinolines, Potent and Selective Neuronal Nitric Oxide Synthase Inhibitors That Target an Isoform-Specific Aspartate.,  63  (9): [PMID:32302123] [10.1021/acs.jmedchem.9b01573]

Source