The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(5-Carbamoyl-1-methyl-1H-pyrrol-2-yl)phenyl (2-(4-phenylpiperazin-1-yl)ethyl)carbamate ID: ALA4517296
PubChem CID: 155540919
Max Phase: Preclinical
Molecular Formula: C25H29N5O3
Molecular Weight: 447.54
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cn1c(C(N)=O)ccc1-c1cccc(OC(=O)NCCN2CCN(c3ccccc3)CC2)c1
Standard InChI: InChI=1S/C25H29N5O3/c1-28-22(10-11-23(28)24(26)31)19-6-5-9-21(18-19)33-25(32)27-12-13-29-14-16-30(17-15-29)20-7-3-2-4-8-20/h2-11,18H,12-17H2,1H3,(H2,26,31)(H,27,32)
Standard InChI Key: JRYNLQPPXGHRTN-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
4.1712 -17.2889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1701 -18.1085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8781 -18.5174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5878 -18.1080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5849 -17.2853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8763 -16.8801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8739 -16.0629 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.5804 -15.6522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5779 -14.8350 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.2893 -16.0586 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.9958 -15.6479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7047 -16.0544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4112 -15.6437 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.1163 -16.0554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8207 -15.6481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8225 -14.8306 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.1137 -14.4219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4032 -14.8308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5270 -14.4244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2347 -14.8353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9423 -14.4280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9434 -13.6099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2310 -13.2009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5264 -13.6106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4647 -18.5198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7185 -18.1868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1712 -18.7937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5792 -19.5018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3786 -19.3324 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.9855 -19.8796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2463 -20.2481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4335 -20.3329 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.7262 -20.9095 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
6 7 1 0
7 8 1 0
8 9 2 0
8 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
13 18 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
16 19 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 25 1 0
2 25 1 0
29 30 1 0
28 31 1 0
31 32 2 0
31 33 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 447.54Molecular Weight (Monoisotopic): 447.2270AlogP: 2.70#Rotatable Bonds: 7Polar Surface Area: 92.83Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 6.93CX LogP: 2.87CX LogD: 2.74Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.58Np Likeness Score: -1.42
References 1. Grillo A, Chemi G, Brogi S, Brindisi M, Relitti N, Fezza F, Fazio D, Castelletti L, Perdona E, Wong A, Lamponi S, Pecorelli A, Benedusi M, Fantacci M, Valoti M, Valacchi G, Micheli F, Novellino E, Campiani G, Butini S, Maccarrone M, Gemma S.. (2019) Development of novel multipotent compounds modulating endocannabinoid and dopaminergic systems., 183 [PMID:31518969 ] [10.1016/j.ejmech.2019.111674 ]