The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-2-((S)-N,3-dimethyl-2-((S)-3-methyl-2-(methylamino)butanamido)butanamido)-N,3-dimethyl-N-((S)-3-methyl-1-oxo-1-(phenethylamino)butan-2-yl)butanamide ID: ALA4517311
PubChem CID: 122201579
Max Phase: Preclinical
Molecular Formula: C31H53N5O4
Molecular Weight: 559.80
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CN[C@H](C(=O)N[C@H](C(=O)N(C)[C@H](C(=O)N(C)[C@H](C(=O)NCCc1ccccc1)C(C)C)C(C)C)C(C)C)C(C)C
Standard InChI: InChI=1S/C31H53N5O4/c1-19(2)24(32-9)28(37)34-25(20(3)4)30(39)36(11)27(22(7)8)31(40)35(10)26(21(5)6)29(38)33-18-17-23-15-13-12-14-16-23/h12-16,19-22,24-27,32H,17-18H2,1-11H3,(H,33,38)(H,34,37)/t24-,25-,26-,27-/m0/s1
Standard InChI Key: JBWATFYEBWYLFY-FWEHEUNISA-N
Molfile:
RDKit 2D
40 40 0 0 0 0 0 0 0 0999 V2000
19.7818 -17.2725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4895 -16.8639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0741 -16.8639 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.7818 -18.0896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0741 -18.4982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1972 -17.2725 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.4895 -16.0467 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.9049 -16.8639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6126 -17.2725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9049 -16.0467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6126 -15.6381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3203 -16.8639 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.6126 -18.0896 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.0281 -17.2725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3203 -16.0467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7358 -16.8639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0281 -18.0896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3203 -18.4982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7358 -18.4982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4435 -17.2725 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.7358 -16.0467 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.4435 -18.0896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1512 -16.8639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8589 -17.2724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1512 -16.0467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8589 -15.6381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8589 -18.0896 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.5666 -16.8639 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.2743 -17.2724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9820 -16.8639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6897 -17.2724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6844 -18.0907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3913 -18.4992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1000 -18.0906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0973 -17.2692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3899 -16.8643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3664 -17.2725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4895 -18.4982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4435 -15.6381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1972 -15.6381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 1 0
1 4 1 6
4 5 1 0
2 6 1 0
2 7 2 0
6 8 1 0
8 9 1 0
8 10 1 1
10 11 1 0
9 12 1 0
9 13 2 0
12 14 1 0
12 15 1 0
14 16 1 0
14 17 1 6
17 18 1 0
17 19 1 0
16 20 1 0
16 21 2 0
20 22 1 0
20 23 1 0
23 24 1 0
23 25 1 1
25 26 1 0
24 27 2 0
24 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 31 1 0
3 37 1 0
4 38 1 0
25 39 1 0
10 40 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 559.80Molecular Weight (Monoisotopic): 559.4098AlogP: 2.70#Rotatable Bonds: 15Polar Surface Area: 110.85Molecular Species: BASEHBA: 5HBD: 3#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.77CX Basic pKa: 8.90CX LogP: 3.67CX LogD: 2.16Aromatic Rings: 1Heavy Atoms: 40QED Weighted: 0.31Np Likeness Score: 0.10
References 1. Zhao L, Cai X, Kaiser M, Bode HB.. (2018) Methionine-Containing Rhabdopeptide/Xenortide-like Peptides from Heterologous Expression of the Biosynthetic Gene Cluster kj12ABC in Escherichia coli., 81 (10): [PMID:30302998 ] [10.1021/acs.jnatprod.8b00425 ]